diff --git a/Makefile b/Makefile index c88ac79..757bcfd 100644 --- a/Makefile +++ b/Makefile @@ -1,147 +1,149 @@ GITREV=`git describe | cut -c 2-` LDFLAGS=-ldflags="-X 'github.com/writeas/writefreely.softwareVer=$(GITREV)'" GOCMD=go GOINSTALL=$(GOCMD) install $(LDFLAGS) GOBUILD=$(GOCMD) build $(LDFLAGS) GOTEST=$(GOCMD) test $(LDFLAGS) GOGET=$(GOCMD) get BINARY_NAME=writefreely +BUILDPATH=build/$(BINARY_NAME) DOCKERCMD=docker IMAGE_NAME=writeas/writefreely TMPBIN=./tmp all : build ci: ci-assets deps cd cmd/writefreely; $(GOBUILD) -v build: assets deps cd cmd/writefreely; $(GOBUILD) -v -tags='sqlite' build-no-sqlite: assets-no-sqlite deps-no-sqlite cd cmd/writefreely; $(GOBUILD) -v -o $(BINARY_NAME) build-linux: deps @hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ $(GOGET) -u github.com/karalabe/xgo; \ fi xgo --targets=linux/amd64, -dest build/ $(LDFLAGS) -tags='sqlite' -out writefreely ./cmd/writefreely build-windows: deps @hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ $(GOGET) -u github.com/karalabe/xgo; \ fi xgo --targets=windows/amd64, -dest build/ $(LDFLAGS) -tags='sqlite' -out writefreely ./cmd/writefreely build-darwin: deps @hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ $(GOGET) -u github.com/karalabe/xgo; \ fi xgo --targets=darwin/amd64, -dest build/ $(LDFLAGS) -tags='sqlite' -out writefreely ./cmd/writefreely build-arm7: deps @hash xgo > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ $(GOGET) -u github.com/karalabe/xgo; \ fi xgo --targets=linux/arm-7, -dest build/ $(LDFLAGS) -tags='sqlite' -out writefreely ./cmd/writefreely build-docker : $(DOCKERCMD) build -t $(IMAGE_NAME):latest -t $(IMAGE_NAME):$(GITREV) . test: $(GOTEST) -v ./... run: dev-assets $(GOINSTALL) -tags='sqlite' ./... $(BINARY_NAME) --debug deps : $(GOGET) -tags='sqlite' -d -v ./... deps-no-sqlite: $(GOGET) -d -v ./... install : build cmd/writefreely/$(BINARY_NAME) --config cmd/writefreely/$(BINARY_NAME) --gen-keys cmd/writefreely/$(BINARY_NAME) --init-db cd less/; $(MAKE) install $(MFLAGS) release : clean ui assets - mkdir build - cp -r templates build - cp -r pages build - cp -r static build - mkdir build/keys + mkdir -p $(BUILDPATH) + cp -r templates $(BUILDPATH) + cp -r pages $(BUILDPATH) + cp -r static $(BUILDPATH) + mkdir $(BUILDPATH)/keys $(MAKE) build-linux - mv build/$(BINARY_NAME)-linux-amd64 build/$(BINARY_NAME) - cd build; tar -cvzf ../$(BINARY_NAME)_$(GITREV)_linux_amd64.tar.gz * - rm build/$(BINARY_NAME) + mv build/$(BINARY_NAME)-linux-amd64 $(BUILDPATH)/$(BINARY_NAME) + tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_amd64.tar.gz -C build $(BINARY_NAME) + rm $(BUILDPATH)/$(BINARY_NAME) $(MAKE) build-arm7 - mv build/$(BINARY_NAME)-linux-arm-7 build/$(BINARY_NAME) - cd build; tar -cvzf ../$(BINARY_NAME)_$(GITREV)_linux_arm7.tar.gz * - rm build/$(BINARY_NAME) + mv build/$(BINARY_NAME)-linux-arm-7 $(BUILDPATH)/$(BINARY_NAME) + tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_arm7.tar.gz -C build $(BINARY_NAME) + rm $(BUILDPATH)/$(BINARY_NAME) $(MAKE) build-darwin - mv build/$(BINARY_NAME)-darwin-10.6-amd64 build/$(BINARY_NAME) - cd build; tar -cvzf ../$(BINARY_NAME)_$(GITREV)_macos_amd64.tar.gz * - rm build/$(BINARY_NAME) + mv build/$(BINARY_NAME)-darwin-10.6-amd64 $(BUILDPATH)/$(BINARY_NAME) + tar -cvzf $(BINARY_NAME)_$(GITREV)_macos_amd64.tar.gz -C build $(BINARY_NAME) + rm $(BUILDPATH)/$(BINARY_NAME) $(MAKE) build-windows - mv build/$(BINARY_NAME)-windows-4.0-amd64.exe build/$(BINARY_NAME).exe - cd build; zip -r ../$(BINARY_NAME)_$(GITREV)_windows_amd64.zip ./* + mv build/$(BINARY_NAME)-windows-4.0-amd64.exe $(BUILDPATH)/$(BINARY_NAME).exe + cd build; zip -r ../$(BINARY_NAME)_$(GITREV)_windows_amd64.zip ./$(BINARY_NAME) + rm $(BUILDPATH)/$(BINARY_NAME) $(MAKE) build-docker $(MAKE) release-docker # This assumes you're on linux/amd64 release-linux : clean ui - mkdir build - cp -r templates build - cp -r pages build - cp -r static build - mkdir build/keys + mkdir -p $(BUILDPATH) + cp -r templates $(BUILDPATH) + cp -r pages $(BUILDPATH) + cp -r static $(BUILDPATH) + mkdir $(BUILDPATH)/keys $(MAKE) build-no-sqlite - mv cmd/writefreely/$(BINARY_NAME) build/$(BINARY_NAME) - cd build; tar -cvzf ../$(BINARY_NAME)_$(GITREV)_linux_amd64.tar.gz * + mv cmd/writefreely/$(BINARY_NAME) $(BUILDPATH)/$(BINARY_NAME) + tar -cvzf $(BINARY_NAME)_$(GITREV)_linux_amd64.tar.gz -C build $(BINARY_NAME) release-docker : $(DOCKERCMD) push $(IMAGE_NAME) ui : force_look cd less/; $(MAKE) $(MFLAGS) assets : generate go-bindata -pkg writefreely -ignore=\\.gitignore -tags="!wflib" schema.sql sqlite.sql assets-no-sqlite: generate go-bindata -pkg writefreely -ignore=\\.gitignore -tags="!wflib" schema.sql dev-assets : generate go-bindata -pkg writefreely -ignore=\\.gitignore -debug -tags="!wflib" schema.sql sqlite.sql lib-assets : generate go-bindata -pkg writefreely -ignore=\\.gitignore -o bindata-lib.go -tags="wflib" schema.sql generate : @hash go-bindata > /dev/null 2>&1; if [ $$? -ne 0 ]; then \ $(GOGET) -u github.com/jteeuwen/go-bindata/go-bindata; \ fi $(TMPBIN): mkdir -p $(TMPBIN) $(TMPBIN)/go-bindata: deps $(TMPBIN) $(GOBUILD) -o $(TMPBIN)/go-bindata github.com/jteeuwen/go-bindata/go-bindata $(TMPBIN)/xgo: deps $(TMPBIN) $(GOBUILD) -o $(TMPBIN)/xgo github.com/karalabe/xgo ci-assets : $(TMPBIN)/go-bindata $(TMPBIN)/go-bindata -pkg writefreely -ignore=\\.gitignore -tags="!wflib" schema.sql sqlite.sql clean : -rm -rf build -rm -rf tmp cd less/; $(MAKE) clean $(MFLAGS) force_look : true diff --git a/account.go b/account.go index a3eb39d..2a66ecf 100644 --- a/account.go +++ b/account.go @@ -1,1069 +1,1070 @@ /* * Copyright © 2018-2019 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "encoding/json" "fmt" + "html/template" + "net/http" + "regexp" + "strings" + "sync" + "time" + "github.com/gorilla/mux" "github.com/gorilla/sessions" "github.com/guregu/null/zero" "github.com/writeas/impart" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/data" "github.com/writeas/web-core/log" "github.com/writeas/writefreely/author" "github.com/writeas/writefreely/config" "github.com/writeas/writefreely/page" - "html/template" - "net/http" - "regexp" - "strings" - "sync" - "time" ) type ( userSettings struct { Username string `schema:"username" json:"username"` Email string `schema:"email" json:"email"` NewPass string `schema:"new-pass" json:"new_pass"` OldPass string `schema:"current-pass" json:"current_pass"` IsLogOut bool `schema:"logout" json:"logout"` } UserPage struct { page.StaticPage PageTitle string Separator template.HTML IsAdmin bool CanInvite bool } ) func NewUserPage(app *App, r *http.Request, u *User, title string, flashes []string) *UserPage { up := &UserPage{ StaticPage: pageForReq(app, r), PageTitle: title, } up.Username = u.Username up.Flashes = flashes up.Path = r.URL.Path up.IsAdmin = u.IsAdmin() up.CanInvite = canUserInvite(app.cfg, up.IsAdmin) return up } func canUserInvite(cfg *config.Config, isAdmin bool) bool { return cfg.App.UserInvites != "" && (isAdmin || cfg.App.UserInvites != "admin") } func (up *UserPage) SetMessaging(u *User) { //up.NeedsAuth = app.db.DoesUserNeedAuth(u.ID) } const ( loginAttemptExpiration = 3 * time.Second ) var actuallyUsernameReg = regexp.MustCompile("username is actually ([a-z0-9\\-]+)\\. Please try that, instead") func apiSignup(app *App, w http.ResponseWriter, r *http.Request) error { _, err := signup(app, w, r) return err } func signup(app *App, w http.ResponseWriter, r *http.Request) (*AuthUser, error) { reqJSON := IsJSON(r.Header.Get("Content-Type")) // Get params var ur userRegistration if reqJSON { decoder := json.NewDecoder(r.Body) err := decoder.Decode(&ur) if err != nil { log.Error("Couldn't parse signup JSON request: %v\n", err) return nil, ErrBadJSON } } else { // Check if user is already logged in u := getUserSession(app, r) if u != nil { return &AuthUser{User: u}, nil } err := r.ParseForm() if err != nil { log.Error("Couldn't parse signup form request: %v\n", err) return nil, ErrBadFormData } err = app.formDecoder.Decode(&ur, r.PostForm) if err != nil { log.Error("Couldn't decode signup form request: %v\n", err) return nil, ErrBadFormData } } return signupWithRegistration(app, ur, w, r) } func signupWithRegistration(app *App, signup userRegistration, w http.ResponseWriter, r *http.Request) (*AuthUser, error) { reqJSON := IsJSON(r.Header.Get("Content-Type")) // Validate required params (alias) if signup.Alias == "" { return nil, impart.HTTPError{http.StatusBadRequest, "A username is required."} } if signup.Pass == "" { return nil, impart.HTTPError{http.StatusBadRequest, "A password is required."} } var desiredUsername string if signup.Normalize { // With this option we simply conform the username to what we expect // without complaining. Since they might've done something funny, like // enter: write.as/Way Out There, we'll use their raw input for the new // collection name and sanitize for the slug / username. desiredUsername = signup.Alias signup.Alias = getSlug(signup.Alias, "") } if !author.IsValidUsername(app.cfg, signup.Alias) { // Ensure the username is syntactically correct. return nil, impart.HTTPError{http.StatusPreconditionFailed, "Username is reserved or isn't valid. It must be at least 3 characters long, and can only include letters, numbers, and hyphens."} } // Handle empty optional params // TODO: remove this var createdWithPass := true hashedPass, err := auth.HashPass([]byte(signup.Pass)) if err != nil { return nil, impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."} } // Create struct to insert u := &User{ Username: signup.Alias, HashedPass: hashedPass, HasPass: createdWithPass, Email: zero.NewString("", signup.Email != ""), Created: time.Now().Truncate(time.Second).UTC(), } if signup.Email != "" { encEmail, err := data.Encrypt(app.keys.EmailKey, signup.Email) if err != nil { log.Error("Unable to encrypt email: %s\n", err) } else { u.Email.String = string(encEmail) } } // Create actual user if err := app.db.CreateUser(app.cfg, u, desiredUsername); err != nil { return nil, err } // Log invite if needed if signup.InviteCode != "" { cu, err := app.db.GetUserForAuth(signup.Alias) if err != nil { return nil, err } err = app.db.CreateInvitedUser(signup.InviteCode, cu.ID) if err != nil { return nil, err } } // Add back unencrypted data for response if signup.Email != "" { u.Email.String = signup.Email } resUser := &AuthUser{ User: u, } if !createdWithPass { resUser.Password = signup.Pass } title := signup.Alias if signup.Normalize { title = desiredUsername } resUser.Collections = &[]Collection{ { Alias: signup.Alias, Title: title, }, } var token string if reqJSON && !signup.Web { token, err = app.db.GetAccessToken(u.ID) if err != nil { return nil, impart.HTTPError{http.StatusInternalServerError, "Could not create access token. Try re-authenticating."} } resUser.AccessToken = token } else { session, err := app.sessionStore.Get(r, cookieName) if err != nil { // The cookie should still save, even if there's an error. // Source: https://github.com/gorilla/sessions/issues/16#issuecomment-143642144 log.Error("Session: %v; ignoring", err) } session.Values[cookieUserVal] = resUser.User.Cookie() err = session.Save(r, w) if err != nil { log.Error("Couldn't save session: %v", err) return nil, err } } if reqJSON { return resUser, impart.WriteSuccess(w, resUser, http.StatusCreated) } return resUser, nil } func viewLogout(app *App, w http.ResponseWriter, r *http.Request) error { session, err := app.sessionStore.Get(r, cookieName) if err != nil { return ErrInternalCookieSession } // Ensure user has an email or password set before they go, so they don't // lose access to their account. val := session.Values[cookieUserVal] var u = &User{} var ok bool if u, ok = val.(*User); !ok { log.Error("Error casting user object on logout. Vals: %+v Resetting cookie.", session.Values) err = session.Save(r, w) if err != nil { log.Error("Couldn't save session on logout: %v", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to save cookie session."} } return impart.HTTPError{http.StatusFound, "/"} } u, err = app.db.GetUserByID(u.ID) if err != nil && err != ErrUserNotFound { return impart.HTTPError{http.StatusInternalServerError, "Unable to fetch user information."} } session.Options.MaxAge = -1 err = session.Save(r, w) if err != nil { log.Error("Couldn't save session on logout: %v", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to save cookie session."} } return impart.HTTPError{http.StatusFound, "/"} } func handleAPILogout(app *App, w http.ResponseWriter, r *http.Request) error { accessToken := r.Header.Get("Authorization") if accessToken == "" { return ErrNoAccessToken } t := auth.GetToken(accessToken) if len(t) == 0 { return ErrNoAccessToken } err := app.db.DeleteToken(t) if err != nil { return err } return impart.HTTPError{Status: http.StatusNoContent} } func viewLogin(app *App, w http.ResponseWriter, r *http.Request) error { var earlyError string oneTimeToken := r.FormValue("with") if oneTimeToken != "" { log.Info("Calling login with one-time token.") err := login(app, w, r) if err != nil { log.Info("Received error: %v", err) earlyError = fmt.Sprintf("%s", err) } } session, err := app.sessionStore.Get(r, cookieName) if err != nil { // Ignore this log.Error("Unable to get session; ignoring: %v", err) } p := &struct { page.StaticPage To string Message template.HTML Flashes []template.HTML LoginUsername string }{ pageForReq(app, r), r.FormValue("to"), template.HTML(""), []template.HTML{}, getTempInfo(app, "login-user", r, w), } if earlyError != "" { p.Flashes = append(p.Flashes, template.HTML(earlyError)) } // Display any error messages flashes, _ := getSessionFlashes(app, w, r, session) for _, flash := range flashes { p.Flashes = append(p.Flashes, template.HTML(flash)) } err = pages["login.tmpl"].ExecuteTemplate(w, "base", p) if err != nil { log.Error("Unable to render login: %v", err) return err } return nil } func webLogin(app *App, w http.ResponseWriter, r *http.Request) error { err := login(app, w, r) if err != nil { username := r.FormValue("alias") // Login request was unsuccessful; save the error in the session and redirect them if err, ok := err.(impart.HTTPError); ok { session, _ := app.sessionStore.Get(r, cookieName) if session != nil { session.AddFlash(err.Message) session.Save(r, w) } if m := actuallyUsernameReg.FindStringSubmatch(err.Message); len(m) > 0 { // Retain fixed username recommendation for the login form username = m[1] } } // Pass along certain information saveTempInfo(app, "login-user", username, r, w) // Retain post-login URL if one was given redirectTo := "/login" postLoginRedirect := r.FormValue("to") if postLoginRedirect != "" { redirectTo += "?to=" + postLoginRedirect } log.Error("Unable to login: %v", err) return impart.HTTPError{http.StatusTemporaryRedirect, redirectTo} } return nil } var loginAttemptUsers = sync.Map{} func login(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r.Header.Get("Content-Type")) oneTimeToken := r.FormValue("with") verbose := r.FormValue("all") == "true" || r.FormValue("verbose") == "1" || r.FormValue("verbose") == "true" || (reqJSON && oneTimeToken != "") redirectTo := r.FormValue("to") if redirectTo == "" { if app.cfg.App.SingleUser { redirectTo = "/me/new" } else { redirectTo = "/" } } var u *User var err error var signin userCredentials // Log in with one-time token if one is given if oneTimeToken != "" { log.Info("Login: Logging user in via token.") userID := app.db.GetUserID(oneTimeToken) if userID == -1 { log.Error("Login: Got user -1 from token") err := ErrBadAccessToken err.Message = "Expired or invalid login code." return err } log.Info("Login: Found user %d.", userID) u, err = app.db.GetUserByID(userID) if err != nil { log.Error("Unable to fetch user on one-time token login: %v", err) return impart.HTTPError{http.StatusInternalServerError, "There was an error retrieving the user you want."} } log.Info("Login: Got user via token") } else { // Get params if reqJSON { decoder := json.NewDecoder(r.Body) err := decoder.Decode(&signin) if err != nil { log.Error("Couldn't parse signin JSON request: %v\n", err) return ErrBadJSON } } else { err := r.ParseForm() if err != nil { log.Error("Couldn't parse signin form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&signin, r.PostForm) if err != nil { log.Error("Couldn't decode signin form request: %v\n", err) return ErrBadFormData } } log.Info("Login: Attempting login for '%s'", signin.Alias) // Validate required params (all) if signin.Alias == "" { msg := "Parameter `alias` required." if signin.Web { msg = "A username is required." } return impart.HTTPError{http.StatusBadRequest, msg} } if !signin.EmailLogin && signin.Pass == "" { msg := "Parameter `pass` required." if signin.Web { msg = "A password is required." } return impart.HTTPError{http.StatusBadRequest, msg} } // Prevent excessive login attempts on the same account // Skip this check in dev environment if !app.cfg.Server.Dev { now := time.Now() attemptExp, att := loginAttemptUsers.LoadOrStore(signin.Alias, now.Add(loginAttemptExpiration)) if att { if attemptExpTime, ok := attemptExp.(time.Time); ok { if attemptExpTime.After(now) { // This user attempted previously, and the period hasn't expired yet return impart.HTTPError{http.StatusTooManyRequests, "You're doing that too much."} } else { // This user attempted previously, but the time expired; free up space loginAttemptUsers.Delete(signin.Alias) } } else { log.Error("Unable to cast expiration to time") } } } // Retrieve password u, err = app.db.GetUserForAuth(signin.Alias) if err != nil { log.Info("Unable to getUserForAuth on %s: %v", signin.Alias, err) if strings.IndexAny(signin.Alias, "@") > 0 { log.Info("Suggesting: %s", ErrUserNotFoundEmail.Message) return ErrUserNotFoundEmail } return err } // Authenticate if u.Email.String == "" { // User has no email set, so check if they haven't added a password, either, // so we can return a more helpful error message. if hasPass, _ := app.db.IsUserPassSet(u.ID); !hasPass { log.Info("Tried logging in to %s, but no password or email.", signin.Alias) return impart.HTTPError{http.StatusPreconditionFailed, "This user never added a password or email address. Please contact us for help."} } } if !auth.Authenticated(u.HashedPass, []byte(signin.Pass)) { return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."} } } if reqJSON && !signin.Web { var token string if r.Header.Get("User-Agent") == "" { // Get last created token when User-Agent is empty token = app.db.FetchLastAccessToken(u.ID) if token == "" { token, err = app.db.GetAccessToken(u.ID) } } else { token, err = app.db.GetAccessToken(u.ID) } if err != nil { log.Error("Login: Unable to create access token: %v", err) return impart.HTTPError{http.StatusInternalServerError, "Could not create access token. Try re-authenticating."} } resUser := getVerboseAuthUser(app, token, u, verbose) return impart.WriteSuccess(w, resUser, http.StatusOK) } session, err := app.sessionStore.Get(r, cookieName) if err != nil { // The cookie should still save, even if there's an error. log.Error("Login: Session: %v; ignoring", err) } // Remove unwanted data session.Values[cookieUserVal] = u.Cookie() err = session.Save(r, w) if err != nil { log.Error("Login: Couldn't save session: %v", err) // TODO: return error } // Send success if reqJSON { return impart.WriteSuccess(w, &AuthUser{User: u}, http.StatusOK) } log.Info("Login: Redirecting to %s", redirectTo) w.Header().Set("Location", redirectTo) w.WriteHeader(http.StatusFound) return nil } func getVerboseAuthUser(app *App, token string, u *User, verbose bool) *AuthUser { resUser := &AuthUser{ AccessToken: token, User: u, } // Fetch verbose user data if requested if verbose { posts, err := app.db.GetUserPosts(u) if err != nil { log.Error("Login: Unable to get user posts: %v", err) } - colls, err := app.db.GetCollections(u) + colls, err := app.db.GetCollections(u, app.cfg.App.Host) if err != nil { log.Error("Login: Unable to get user collections: %v", err) } passIsSet, err := app.db.IsUserPassSet(u.ID) if err != nil { // TODO: correct error meesage log.Error("Login: Unable to get user collections: %v", err) } resUser.Posts = posts resUser.Collections = colls resUser.User.HasPass = passIsSet } return resUser } func viewExportOptions(app *App, u *User, w http.ResponseWriter, r *http.Request) error { // Fetch extra user data p := NewUserPage(app, r, u, "Export", nil) showUserPage(w, "export", p) return nil } func viewExportPosts(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error) { var filename string var u = &User{} reqJSON := IsJSON(r.Header.Get("Content-Type")) if reqJSON { // Use given Authorization header accessToken := r.Header.Get("Authorization") if accessToken == "" { return nil, filename, ErrNoAccessToken } userID := app.db.GetUserID(accessToken) if userID == -1 { return nil, filename, ErrBadAccessToken } var err error u, err = app.db.GetUserByID(userID) if err != nil { return nil, filename, impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve requested user."} } } else { // Use user cookie session, err := app.sessionStore.Get(r, cookieName) if err != nil { // The cookie should still save, even if there's an error. log.Error("Session: %v; ignoring", err) } val := session.Values[cookieUserVal] var ok bool if u, ok = val.(*User); !ok { return nil, filename, ErrNotLoggedIn } } filename = u.Username + "-posts-" + time.Now().Truncate(time.Second).UTC().Format("200601021504") // Fetch data we're exporting var err error var data []byte posts, err := app.db.GetUserPosts(u) if err != nil { return data, filename, err } // Export as CSV if strings.HasSuffix(r.URL.Path, ".csv") { data = exportPostsCSV(u, posts) return data, filename, err } if strings.HasSuffix(r.URL.Path, ".zip") { data = exportPostsZip(u, posts) return data, filename, err } if r.FormValue("pretty") == "1" { data, err = json.MarshalIndent(posts, "", "\t") } else { data, err = json.Marshal(posts) } return data, filename, err } func viewExportFull(app *App, w http.ResponseWriter, r *http.Request) ([]byte, string, error) { var err error filename := "" u := getUserSession(app, r) if u == nil { return nil, filename, ErrNotLoggedIn } filename = u.Username + "-" + time.Now().Truncate(time.Second).UTC().Format("200601021504") exportUser := compileFullExport(app, u) var data []byte if r.FormValue("pretty") == "1" { data, err = json.MarshalIndent(exportUser, "", "\t") } else { data, err = json.Marshal(exportUser) } return data, filename, err } func viewMeAPI(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r.Header.Get("Content-Type")) uObj := struct { ID int64 `json:"id,omitempty"` Username string `json:"username,omitempty"` }{} var err error if reqJSON { _, uObj.Username, err = app.db.GetUserDataFromToken(r.Header.Get("Authorization")) if err != nil { return err } } else { u := getUserSession(app, r) if u == nil { return impart.WriteSuccess(w, uObj, http.StatusOK) } uObj.Username = u.Username } return impart.WriteSuccess(w, uObj, http.StatusOK) } func viewMyPostsAPI(app *App, u *User, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r.Header.Get("Content-Type")) if !reqJSON { return ErrBadRequestedType } var err error p := GetPostsCache(u.ID) if p == nil { userPostsCache.Lock() if userPostsCache.users[u.ID].ready == nil { userPostsCache.users[u.ID] = postsCacheItem{ready: make(chan struct{})} userPostsCache.Unlock() p, err = app.db.GetUserPosts(u) if err != nil { return err } CachePosts(u.ID, p) } else { userPostsCache.Unlock() <-userPostsCache.users[u.ID].ready p = GetPostsCache(u.ID) } } return impart.WriteSuccess(w, p, http.StatusOK) } func viewMyCollectionsAPI(app *App, u *User, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r.Header.Get("Content-Type")) if !reqJSON { return ErrBadRequestedType } - p, err := app.db.GetCollections(u) + p, err := app.db.GetCollections(u, app.cfg.App.Host) if err != nil { return err } return impart.WriteSuccess(w, p, http.StatusOK) } func viewArticles(app *App, u *User, w http.ResponseWriter, r *http.Request) error { p, err := app.db.GetAnonymousPosts(u) if err != nil { log.Error("unable to fetch anon posts: %v", err) } // nil-out AnonymousPosts slice for easy detection in the template if p != nil && len(*p) == 0 { p = nil } f, err := getSessionFlashes(app, w, r, nil) if err != nil { log.Error("unable to fetch flashes: %v", err) } - c, err := app.db.GetPublishableCollections(u) + c, err := app.db.GetPublishableCollections(u, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) } d := struct { *UserPage AnonymousPosts *[]PublicPost Collections *[]Collection }{ UserPage: NewUserPage(app, r, u, u.Username+"'s Posts", f), AnonymousPosts: p, Collections: c, } d.UserPage.SetMessaging(u) w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate") w.Header().Set("Expires", "Thu, 04 Oct 1990 20:00:00 GMT") showUserPage(w, "articles", d) return nil } func viewCollections(app *App, u *User, w http.ResponseWriter, r *http.Request) error { - c, err := app.db.GetCollections(u) + c, err := app.db.GetCollections(u, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) return fmt.Errorf("No collections") } f, _ := getSessionFlashes(app, w, r, nil) uc, _ := app.db.GetUserCollectionCount(u.ID) // TODO: handle any errors d := struct { *UserPage Collections *[]Collection UsedCollections, TotalCollections int NewBlogsDisabled bool }{ UserPage: NewUserPage(app, r, u, u.Username+"'s Blogs", f), Collections: c, UsedCollections: int(uc), NewBlogsDisabled: !app.cfg.App.CanCreateBlogs(uc), } d.UserPage.SetMessaging(u) showUserPage(w, "collections", d) return nil } func viewEditCollection(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) c, err := app.db.GetCollection(vars["collection"]) if err != nil { return err } if c.OwnerID != u.ID { return ErrCollectionNotFound } flashes, _ := getSessionFlashes(app, w, r, nil) obj := struct { *UserPage *Collection }{ UserPage: NewUserPage(app, r, u, "Edit "+c.DisplayTitle(), flashes), Collection: c, } showUserPage(w, "collection", obj) return nil } func updateSettings(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r.Header.Get("Content-Type")) var s userSettings var u *User var sess *sessions.Session var err error if reqJSON { accessToken := r.Header.Get("Authorization") if accessToken == "" { return ErrNoAccessToken } u, err = app.db.GetAPIUser(accessToken) if err != nil { return ErrBadAccessToken } decoder := json.NewDecoder(r.Body) err := decoder.Decode(&s) if err != nil { log.Error("Couldn't parse settings JSON request: %v\n", err) return ErrBadJSON } // Prevent all username updates // TODO: support changing username via JSON API request s.Username = "" } else { u, sess = getUserAndSession(app, r) if u == nil { return ErrNotLoggedIn } err := r.ParseForm() if err != nil { log.Error("Couldn't parse settings form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&s, r.PostForm) if err != nil { log.Error("Couldn't decode settings form request: %v\n", err) return ErrBadFormData } } // Do update postUpdateReturn := r.FormValue("return") redirectTo := "/me/settings" if s.IsLogOut { redirectTo += "?logout=1" } else if postUpdateReturn != "" { redirectTo = postUpdateReturn } // Only do updates on values we need if s.Username != "" && s.Username == u.Username { // Username hasn't actually changed; blank it out s.Username = "" } err = app.db.ChangeSettings(app, u, &s) if err != nil { if reqJSON { return err } if err, ok := err.(impart.HTTPError); ok { addSessionFlash(app, w, r, err.Message, nil) } } else { // Successful update. if reqJSON { return impart.WriteSuccess(w, u, http.StatusOK) } if s.IsLogOut { redirectTo = "/me/logout" } else { sess.Values[cookieUserVal] = u.Cookie() addSessionFlash(app, w, r, "Account updated.", nil) } } w.Header().Set("Location", redirectTo) w.WriteHeader(http.StatusFound) return nil } func updatePassphrase(app *App, w http.ResponseWriter, r *http.Request) error { accessToken := r.Header.Get("Authorization") if accessToken == "" { return ErrNoAccessToken } curPass := r.FormValue("current") newPass := r.FormValue("new") // Ensure a new password is given (always required) if newPass == "" { return impart.HTTPError{http.StatusBadRequest, "Provide a new password."} } userID, sudo := app.db.GetUserIDPrivilege(accessToken) if userID == -1 { return ErrBadAccessToken } // Ensure a current password is given if the access token doesn't have sudo // privileges. if !sudo && curPass == "" { return impart.HTTPError{http.StatusBadRequest, "Provide current password."} } // Hash the new password hashedPass, err := auth.HashPass([]byte(newPass)) if err != nil { return impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."} } // Do update err = app.db.ChangePassphrase(userID, sudo, curPass, hashedPass) if err != nil { return err } return impart.WriteSuccess(w, struct{}{}, http.StatusOK) } func viewStats(app *App, u *User, w http.ResponseWriter, r *http.Request) error { var c *Collection var err error vars := mux.Vars(r) alias := vars["collection"] if alias != "" { c, err = app.db.GetCollection(alias) if err != nil { return err } if c.OwnerID != u.ID { return ErrCollectionNotFound } } topPosts, err := app.db.GetTopPosts(u, alias) if err != nil { log.Error("Unable to get top posts: %v", err) return err } flashes, _ := getSessionFlashes(app, w, r, nil) titleStats := "" if c != nil { titleStats = c.DisplayTitle() + " " } obj := struct { *UserPage VisitsBlog string Collection *Collection TopPosts *[]PublicPost APFollowers int }{ UserPage: NewUserPage(app, r, u, titleStats+"Stats", flashes), VisitsBlog: alias, Collection: c, TopPosts: topPosts, } if app.cfg.App.Federation { folls, err := app.db.GetAPFollowers(c) if err != nil { return err } obj.APFollowers = len(*folls) } showUserPage(w, "stats", obj) return nil } func viewSettings(app *App, u *User, w http.ResponseWriter, r *http.Request) error { fullUser, err := app.db.GetUserByID(u.ID) if err != nil { log.Error("Unable to get user for settings: %s", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."} } passIsSet, err := app.db.IsUserPassSet(u.ID) if err != nil { log.Error("Unable to get isUserPassSet for settings: %s", err) return impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data. The humans have been alerted."} } flashes, _ := getSessionFlashes(app, w, r, nil) obj := struct { *UserPage Email string HasPass bool IsLogOut bool }{ UserPage: NewUserPage(app, r, u, "Account Settings", flashes), Email: fullUser.EmailClear(app.keys), HasPass: passIsSet, IsLogOut: r.FormValue("logout") == "1", } showUserPage(w, "settings", obj) return nil } func saveTempInfo(app *App, key, val string, r *http.Request, w http.ResponseWriter) error { session, err := app.sessionStore.Get(r, "t") if err != nil { return ErrInternalCookieSession } session.Values[key] = val err = session.Save(r, w) if err != nil { log.Error("Couldn't saveTempInfo for key-val (%s:%s): %v", key, val, err) } return err } func getTempInfo(app *App, key string, r *http.Request, w http.ResponseWriter) string { session, err := app.sessionStore.Get(r, "t") if err != nil { return "" } // Get the information var s = "" var ok bool if s, ok = session.Values[key].(string); !ok { return "" } // Delete cookie session.Options.MaxAge = -1 err = session.Save(r, w) if err != nil { log.Error("Couldn't erase temp data for key %s: %v", key, err) } // Return value return s } diff --git a/admin.go b/admin.go index 4269bcc..f316e3e 100644 --- a/admin.go +++ b/admin.go @@ -1,458 +1,459 @@ /* * Copyright © 2018-2019 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "database/sql" "fmt" + "net/http" + "runtime" + "strconv" + "time" + "github.com/gogits/gogs/pkg/tool" "github.com/gorilla/mux" "github.com/writeas/impart" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/log" "github.com/writeas/writefreely/config" - "net/http" - "runtime" - "strconv" - "time" ) var ( appStartTime = time.Now() sysStatus systemStatus ) const adminUsersPerPage = 30 type systemStatus struct { Uptime string NumGoroutine int // General statistics. MemAllocated string // bytes allocated and still in use MemTotal string // bytes allocated (even if freed) MemSys string // bytes obtained from system (sum of XxxSys below) Lookups uint64 // number of pointer lookups MemMallocs uint64 // number of mallocs MemFrees uint64 // number of frees // Main allocation heap statistics. HeapAlloc string // bytes allocated and still in use HeapSys string // bytes obtained from system HeapIdle string // bytes in idle spans HeapInuse string // bytes in non-idle span HeapReleased string // bytes released to the OS HeapObjects uint64 // total number of allocated objects // Low-level fixed-size structure allocator statistics. // Inuse is bytes used now. // Sys is bytes obtained from system. StackInuse string // bootstrap stacks StackSys string MSpanInuse string // mspan structures MSpanSys string MCacheInuse string // mcache structures MCacheSys string BuckHashSys string // profiling bucket hash table GCSys string // GC metadata OtherSys string // other system allocations // Garbage collector statistics. NextGC string // next run in HeapAlloc time (bytes) LastGC string // last run in absolute time (ns) PauseTotalNs string PauseNs string // circular buffer of recent GC pause times, most recent at [(NumGC+255)%256] NumGC uint32 } type inspectedCollection struct { CollectionObj Followers int LastPost string } type instanceContent struct { ID string Type string Title sql.NullString Content string Updated time.Time } func (c instanceContent) UpdatedFriendly() string { /* // TODO: accept a locale in this method and use that for the format var loc monday.Locale = monday.LocaleEnUS return monday.Format(u.Created, monday.DateTimeFormatsByLocale[loc], loc) */ return c.Updated.Format("January 2, 2006, 3:04 PM") } func handleViewAdminDash(app *App, u *User, w http.ResponseWriter, r *http.Request) error { updateAppStats() p := struct { *UserPage SysStatus systemStatus Config config.AppCfg Message, ConfigMessage string }{ UserPage: NewUserPage(app, r, u, "Admin", nil), SysStatus: sysStatus, Config: app.cfg.App, Message: r.FormValue("m"), ConfigMessage: r.FormValue("cm"), } showUserPage(w, "admin", p) return nil } func handleViewAdminUsers(app *App, u *User, w http.ResponseWriter, r *http.Request) error { p := struct { *UserPage Config config.AppCfg Message string Users *[]User CurPage int TotalUsers int64 TotalPages []int }{ UserPage: NewUserPage(app, r, u, "Users", nil), Config: app.cfg.App, Message: r.FormValue("m"), } p.TotalUsers = app.db.GetAllUsersCount() ttlPages := p.TotalUsers / adminUsersPerPage p.TotalPages = []int{} for i := 1; i <= int(ttlPages); i++ { p.TotalPages = append(p.TotalPages, i) } var err error p.CurPage, err = strconv.Atoi(r.FormValue("p")) if err != nil || p.CurPage < 1 { p.CurPage = 1 } else if p.CurPage > int(ttlPages) { p.CurPage = int(ttlPages) } p.Users, err = app.db.GetAllUsers(uint(p.CurPage)) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get users: %v", err)} } showUserPage(w, "users", p) return nil } func handleViewAdminUser(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) username := vars["username"] if username == "" { return impart.HTTPError{http.StatusFound, "/admin/users"} } p := struct { *UserPage Config config.AppCfg Message string User *User Colls []inspectedCollection LastPost string TotalPosts int64 }{ Config: app.cfg.App, Message: r.FormValue("m"), Colls: []inspectedCollection{}, } var err error p.User, err = app.db.GetUserForAuth(username) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user: %v", err)} } p.UserPage = NewUserPage(app, r, u, p.User.Username, nil) p.TotalPosts = app.db.GetUserPostsCount(p.User.ID) lp, err := app.db.GetUserLastPostTime(p.User.ID) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's last post time: %v", err)} } if lp != nil { p.LastPost = lp.Format("January 2, 2006, 3:04 PM") } - colls, err := app.db.GetCollections(p.User) + colls, err := app.db.GetCollections(p.User, app.cfg.App.Host) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get user's collections: %v", err)} } for _, c := range *colls { ic := inspectedCollection{ CollectionObj: CollectionObj{Collection: c}, } if app.cfg.App.Federation { folls, err := app.db.GetAPFollowers(&c) if err == nil { // TODO: handle error here (at least log it) ic.Followers = len(*folls) } } app.db.GetPostsCount(&ic.CollectionObj, true) lp, err := app.db.GetCollectionLastPostTime(c.ID) if err != nil { log.Error("Didn't get last post time for collection %d: %v", c.ID, err) } if lp != nil { ic.LastPost = lp.Format("January 2, 2006, 3:04 PM") } p.Colls = append(p.Colls, ic) } showUserPage(w, "view-user", p) return nil } func handleViewAdminPages(app *App, u *User, w http.ResponseWriter, r *http.Request) error { p := struct { *UserPage Config config.AppCfg Message string Pages []*instanceContent }{ UserPage: NewUserPage(app, r, u, "Pages", nil), Config: app.cfg.App, Message: r.FormValue("m"), } var err error p.Pages, err = app.db.GetInstancePages() if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get pages: %v", err)} } // Add in default pages var hasAbout, hasPrivacy bool for i, c := range p.Pages { if hasAbout && hasPrivacy { break } if c.ID == "about" { hasAbout = true if !c.Title.Valid { p.Pages[i].Title = defaultAboutTitle(app.cfg) } } else if c.ID == "privacy" { hasPrivacy = true if !c.Title.Valid { p.Pages[i].Title = defaultPrivacyTitle() } } } if !hasAbout { p.Pages = append(p.Pages, &instanceContent{ ID: "about", Title: defaultAboutTitle(app.cfg), Content: defaultAboutPage(app.cfg), Updated: defaultPageUpdatedTime, }) } if !hasPrivacy { p.Pages = append(p.Pages, &instanceContent{ ID: "privacy", Title: defaultPrivacyTitle(), Content: defaultPrivacyPolicy(app.cfg), Updated: defaultPageUpdatedTime, }) } showUserPage(w, "pages", p) return nil } func handleViewAdminPage(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) slug := vars["slug"] if slug == "" { return impart.HTTPError{http.StatusFound, "/admin/pages"} } p := struct { *UserPage Config config.AppCfg Message string Banner *instanceContent Content *instanceContent }{ Config: app.cfg.App, Message: r.FormValue("m"), } var err error // Get pre-defined pages, or select slug if slug == "about" { p.Content, err = getAboutPage(app) } else if slug == "privacy" { p.Content, err = getPrivacyPage(app) } else if slug == "landing" { p.Banner, err = getLandingBanner(app) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get banner: %v", err)} } p.Content, err = getLandingBody(app) p.Content.ID = "landing" } else if slug == "reader" { p.Content, err = getReaderSection(app) } else { p.Content, err = app.db.GetDynamicContent(slug) } if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get page: %v", err)} } title := "New page" if p.Content != nil { title = "Edit " + p.Content.ID } else { p.Content = &instanceContent{} } p.UserPage = NewUserPage(app, r, u, title, nil) showUserPage(w, "view-page", p) return nil } func handleAdminUpdateSite(app *App, u *User, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) id := vars["page"] // Validate if id != "about" && id != "privacy" && id != "landing" && id != "reader" { return impart.HTTPError{http.StatusNotFound, "No such page."} } var err error m := "" if id == "landing" { // Handle special landing page err = app.db.UpdateDynamicContent("landing-banner", "", r.FormValue("banner"), "section") if err != nil { m = "?m=" + err.Error() return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m} } err = app.db.UpdateDynamicContent("landing-body", "", r.FormValue("content"), "section") } else if id == "reader" { // Update sections with titles err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "section") } else { // Update page err = app.db.UpdateDynamicContent(id, r.FormValue("title"), r.FormValue("content"), "page") } if err != nil { m = "?m=" + err.Error() } return impart.HTTPError{http.StatusFound, "/admin/page/" + id + m} } func handleAdminUpdateConfig(apper Apper, u *User, w http.ResponseWriter, r *http.Request) error { apper.App().cfg.App.SiteName = r.FormValue("site_name") apper.App().cfg.App.SiteDesc = r.FormValue("site_desc") apper.App().cfg.App.Landing = r.FormValue("landing") apper.App().cfg.App.OpenRegistration = r.FormValue("open_registration") == "on" mul, err := strconv.Atoi(r.FormValue("min_username_len")) if err == nil { apper.App().cfg.App.MinUsernameLen = mul } mb, err := strconv.Atoi(r.FormValue("max_blogs")) if err == nil { apper.App().cfg.App.MaxBlogs = mb } apper.App().cfg.App.Federation = r.FormValue("federation") == "on" apper.App().cfg.App.PublicStats = r.FormValue("public_stats") == "on" apper.App().cfg.App.Private = r.FormValue("private") == "on" apper.App().cfg.App.LocalTimeline = r.FormValue("local_timeline") == "on" if apper.App().cfg.App.LocalTimeline && apper.App().timeline == nil { log.Info("Initializing local timeline...") initLocalTimeline(apper.App()) } apper.App().cfg.App.UserInvites = r.FormValue("user_invites") if apper.App().cfg.App.UserInvites == "none" { apper.App().cfg.App.UserInvites = "" } apper.App().cfg.App.DefaultVisibility = r.FormValue("default_visibility") m := "?cm=Configuration+saved." err = apper.SaveConfig(apper.App().cfg) if err != nil { m = "?cm=" + err.Error() } return impart.HTTPError{http.StatusFound, "/admin" + m + "#config"} } func updateAppStats() { sysStatus.Uptime = tool.TimeSincePro(appStartTime) m := new(runtime.MemStats) runtime.ReadMemStats(m) sysStatus.NumGoroutine = runtime.NumGoroutine() sysStatus.MemAllocated = tool.FileSize(int64(m.Alloc)) sysStatus.MemTotal = tool.FileSize(int64(m.TotalAlloc)) sysStatus.MemSys = tool.FileSize(int64(m.Sys)) sysStatus.Lookups = m.Lookups sysStatus.MemMallocs = m.Mallocs sysStatus.MemFrees = m.Frees sysStatus.HeapAlloc = tool.FileSize(int64(m.HeapAlloc)) sysStatus.HeapSys = tool.FileSize(int64(m.HeapSys)) sysStatus.HeapIdle = tool.FileSize(int64(m.HeapIdle)) sysStatus.HeapInuse = tool.FileSize(int64(m.HeapInuse)) sysStatus.HeapReleased = tool.FileSize(int64(m.HeapReleased)) sysStatus.HeapObjects = m.HeapObjects sysStatus.StackInuse = tool.FileSize(int64(m.StackInuse)) sysStatus.StackSys = tool.FileSize(int64(m.StackSys)) sysStatus.MSpanInuse = tool.FileSize(int64(m.MSpanInuse)) sysStatus.MSpanSys = tool.FileSize(int64(m.MSpanSys)) sysStatus.MCacheInuse = tool.FileSize(int64(m.MCacheInuse)) sysStatus.MCacheSys = tool.FileSize(int64(m.MCacheSys)) sysStatus.BuckHashSys = tool.FileSize(int64(m.BuckHashSys)) sysStatus.GCSys = tool.FileSize(int64(m.GCSys)) sysStatus.OtherSys = tool.FileSize(int64(m.OtherSys)) sysStatus.NextGC = tool.FileSize(int64(m.NextGC)) sysStatus.LastGC = fmt.Sprintf("%.1fs", float64(time.Now().UnixNano()-int64(m.LastGC))/1000/1000/1000) sysStatus.PauseTotalNs = fmt.Sprintf("%.1fs", float64(m.PauseTotalNs)/1000/1000/1000) sysStatus.PauseNs = fmt.Sprintf("%.3fs", float64(m.PauseNs[(m.NumGC+255)%256])/1000/1000/1000) sysStatus.NumGC = m.NumGC } func adminResetPassword(app *App, u *User, newPass string) error { hashedPass, err := auth.HashPass([]byte(newPass)) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not create password hash: %v", err)} } err = app.db.ChangePassphrase(u.ID, true, "", hashedPass) if err != nil { return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not update passphrase: %v", err)} } return nil } diff --git a/app.go b/app.go index 1e24c75..514c7c8 100644 --- a/app.go +++ b/app.go @@ -1,821 +1,826 @@ /* * Copyright © 2018-2019 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "crypto/tls" "database/sql" "fmt" "html/template" "io/ioutil" "net/http" "net/url" "os" "os/signal" "path/filepath" "regexp" "strings" "syscall" "time" "github.com/gorilla/mux" "github.com/gorilla/schema" "github.com/gorilla/sessions" "github.com/manifoldco/promptui" "github.com/writeas/go-strip-markdown" "github.com/writeas/impart" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/converter" "github.com/writeas/web-core/log" "github.com/writeas/writefreely/author" "github.com/writeas/writefreely/config" "github.com/writeas/writefreely/key" "github.com/writeas/writefreely/migrations" "github.com/writeas/writefreely/page" "golang.org/x/crypto/acme/autocert" ) const ( staticDir = "static" assumedTitleLen = 80 postsPerPage = 10 serverSoftware = "WriteFreely" softwareURL = "https://writefreely.org" ) var ( debugging bool // Software version can be set from git env using -ldflags softwareVer = "0.10.0" // DEPRECATED VARS isSingleUser bool ) // App holds data and configuration for an individual WriteFreely instance. type App struct { router *mux.Router shttp *http.ServeMux db *datastore cfg *config.Config cfgFile string keys *key.Keychain sessionStore *sessions.CookieStore formDecoder *schema.Decoder timeline *localTimeline } // DB returns the App's datastore func (app *App) DB() *datastore { return app.db } // Router returns the App's router func (app *App) Router() *mux.Router { return app.router } // Config returns the App's current configuration. func (app *App) Config() *config.Config { return app.cfg } // SetConfig updates the App's Config to the given value. func (app *App) SetConfig(cfg *config.Config) { app.cfg = cfg } // SetKeys updates the App's Keychain to the given value. func (app *App) SetKeys(k *key.Keychain) { app.keys = k } // Apper is the interface for getting data into and out of a WriteFreely // instance (or "App"). // // App returns the App for the current instance. // // LoadConfig reads an app configuration into the App, returning any error // encountered. // // SaveConfig persists the current App configuration. // // LoadKeys reads the App's encryption keys and loads them into its // key.Keychain. type Apper interface { App() *App LoadConfig() error SaveConfig(*config.Config) error LoadKeys() error ReqLog(r *http.Request, status int, timeSince time.Duration) string } // App returns the App func (app *App) App() *App { return app } // LoadConfig loads and parses a config file. func (app *App) LoadConfig() error { log.Info("Loading %s configuration...", app.cfgFile) cfg, err := config.Load(app.cfgFile) if err != nil { log.Error("Unable to load configuration: %v", err) os.Exit(1) return err } app.cfg = cfg return nil } // SaveConfig saves the given Config to disk -- namely, to the App's cfgFile. func (app *App) SaveConfig(c *config.Config) error { return config.Save(c, app.cfgFile) } // LoadKeys reads all needed keys from disk into the App. In order to use the // configured `Server.KeysParentDir`, you must call initKeyPaths(App) before // this. func (app *App) LoadKeys() error { var err error app.keys = &key.Keychain{} if debugging { log.Info(" %s", emailKeyPath) } app.keys.EmailKey, err = ioutil.ReadFile(emailKeyPath) if err != nil { return err } if debugging { log.Info(" %s", cookieAuthKeyPath) } app.keys.CookieAuthKey, err = ioutil.ReadFile(cookieAuthKeyPath) if err != nil { return err } if debugging { log.Info(" %s", cookieKeyPath) } app.keys.CookieKey, err = ioutil.ReadFile(cookieKeyPath) if err != nil { return err } return nil } func (app *App) ReqLog(r *http.Request, status int, timeSince time.Duration) string { return fmt.Sprintf("\"%s %s\" %d %s \"%s\"", r.Method, r.RequestURI, status, timeSince, r.UserAgent()) } // handleViewHome shows page at root path. It checks the configuration and // authentication state to show the correct page. func handleViewHome(app *App, w http.ResponseWriter, r *http.Request) error { if app.cfg.App.SingleUser { // Render blog index return handleViewCollection(app, w, r) } // Multi-user instance forceLanding := r.FormValue("landing") == "1" if !forceLanding { // Show correct page based on user auth status and configured landing path u := getUserSession(app, r) if app.cfg.App.Chorus { // This instance is focused on reading, so show Reader on home route if not // private or a private-instance user is logged in. if !app.cfg.App.Private || u != nil { return viewLocalTimeline(app, w, r) } } if u != nil { // User is logged in, so show the Pad return handleViewPad(app, w, r) } if land := app.cfg.App.LandingPath(); land != "/" { return impart.HTTPError{http.StatusFound, land} } } return handleViewLanding(app, w, r) } func handleViewLanding(app *App, w http.ResponseWriter, r *http.Request) error { forceLanding := r.FormValue("landing") == "1" p := struct { page.StaticPage Flashes []template.HTML Banner template.HTML Content template.HTML ForcedLanding bool }{ StaticPage: pageForReq(app, r), ForcedLanding: forceLanding, } banner, err := getLandingBanner(app) if err != nil { log.Error("unable to get landing banner: %v", err) return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get banner: %v", err)} } p.Banner = template.HTML(applyMarkdown([]byte(banner.Content), "", app.cfg)) content, err := getLandingBody(app) if err != nil { log.Error("unable to get landing content: %v", err) return impart.HTTPError{http.StatusInternalServerError, fmt.Sprintf("Could not get content: %v", err)} } p.Content = template.HTML(applyMarkdown([]byte(content.Content), "", app.cfg)) // Get error messages session, err := app.sessionStore.Get(r, cookieName) if err != nil { // Ignore this log.Error("Unable to get session in handleViewHome; ignoring: %v", err) } flashes, _ := getSessionFlashes(app, w, r, session) for _, flash := range flashes { p.Flashes = append(p.Flashes, template.HTML(flash)) } // Show landing page return renderPage(w, "landing.tmpl", p) } func handleTemplatedPage(app *App, w http.ResponseWriter, r *http.Request, t *template.Template) error { p := struct { page.StaticPage ContentTitle string Content template.HTML PlainContent string Updated string AboutStats *InstanceStats }{ StaticPage: pageForReq(app, r), } if r.URL.Path == "/about" || r.URL.Path == "/privacy" { var c *instanceContent var err error if r.URL.Path == "/about" { c, err = getAboutPage(app) // Fetch stats p.AboutStats = &InstanceStats{} p.AboutStats.NumPosts, _ = app.db.GetTotalPosts() p.AboutStats.NumBlogs, _ = app.db.GetTotalCollections() } else { c, err = getPrivacyPage(app) } if err != nil { return err } p.ContentTitle = c.Title.String p.Content = template.HTML(applyMarkdown([]byte(c.Content), "", app.cfg)) p.PlainContent = shortPostDescription(stripmd.Strip(c.Content)) if !c.Updated.IsZero() { p.Updated = c.Updated.Format("January 2, 2006") } } // Serve templated page err := t.ExecuteTemplate(w, "base", p) if err != nil { log.Error("Unable to render page: %v", err) } return nil } func pageForReq(app *App, r *http.Request) page.StaticPage { p := page.StaticPage{ AppCfg: app.cfg.App, Path: r.URL.Path, Version: "v" + softwareVer, } // Add user information, if given var u *User accessToken := r.FormValue("t") if accessToken != "" { userID := app.db.GetUserID(accessToken) if userID != -1 { var err error u, err = app.db.GetUserByID(userID) if err == nil { p.Username = u.Username } } } else { u = getUserSession(app, r) if u != nil { p.Username = u.Username p.IsAdmin = u != nil && u.IsAdmin() p.CanInvite = canUserInvite(app.cfg, p.IsAdmin) } } p.CanViewReader = !app.cfg.App.Private || u != nil return p } var fileRegex = regexp.MustCompile("/([^/]*\\.[^/]*)$") // Initialize loads the app configuration and initializes templates, keys, // session, route handlers, and the database connection. func Initialize(apper Apper, debug bool) (*App, error) { debugging = debug apper.LoadConfig() // Load templates err := InitTemplates(apper.App().Config()) if err != nil { return nil, fmt.Errorf("load templates: %s", err) } // Load keys and set up session initKeyPaths(apper.App()) // TODO: find a better way to do this, since it's unneeded in all Apper implementations err = InitKeys(apper) if err != nil { return nil, fmt.Errorf("init keys: %s", err) } apper.App().InitSession() apper.App().InitDecoder() err = ConnectToDatabase(apper.App()) if err != nil { return nil, fmt.Errorf("connect to DB: %s", err) } // Handle local timeline, if enabled if apper.App().cfg.App.LocalTimeline { log.Info("Initializing local timeline...") initLocalTimeline(apper.App()) } return apper.App(), nil } func Serve(app *App, r *mux.Router) { log.Info("Going to serve...") isSingleUser = app.cfg.App.SingleUser app.cfg.Server.Dev = debugging // Handle shutdown c := make(chan os.Signal, 2) signal.Notify(c, os.Interrupt, syscall.SIGTERM) go func() { <-c log.Info("Shutting down...") shutdown(app) log.Info("Done.") os.Exit(0) }() // Start web application server var bindAddress = app.cfg.Server.Bind if bindAddress == "" { bindAddress = "localhost" } var err error if app.cfg.IsSecureStandalone() { if app.cfg.Server.Autocert { m := &autocert.Manager{ Prompt: autocert.AcceptTOS, Cache: autocert.DirCache(app.cfg.Server.TLSCertPath), } host, err := url.Parse(app.cfg.App.Host) if err != nil { log.Error("[WARNING] Unable to parse configured host! %s", err) log.Error(`[WARNING] ALL hosts are allowed, which can open you to an attack where clients connect to a server by IP address and pretend to be asking for an incorrect host name, and cause you to reach the CA's rate limit for certificate requests. We recommend supplying a valid host name.`) log.Info("Using autocert on ANY host") } else { log.Info("Using autocert on host %s", host.Host) m.HostPolicy = autocert.HostWhitelist(host.Host) } s := &http.Server{ Addr: ":https", Handler: r, TLSConfig: &tls.Config{ GetCertificate: m.GetCertificate, }, } s.SetKeepAlivesEnabled(false) go func() { log.Info("Serving redirects on http://%s:80", bindAddress) err = http.ListenAndServe(":80", m.HTTPHandler(nil)) log.Error("Unable to start redirect server: %v", err) }() log.Info("Serving on https://%s:443", bindAddress) log.Info("---") err = s.ListenAndServeTLS("", "") } else { go func() { log.Info("Serving redirects on http://%s:80", bindAddress) err = http.ListenAndServe(fmt.Sprintf("%s:80", bindAddress), http.HandlerFunc(func(w http.ResponseWriter, r *http.Request) { http.Redirect(w, r, app.cfg.App.Host, http.StatusMovedPermanently) })) log.Error("Unable to start redirect server: %v", err) }() log.Info("Serving on https://%s:443", bindAddress) log.Info("Using manual certificates") log.Info("---") err = http.ListenAndServeTLS(fmt.Sprintf("%s:443", bindAddress), app.cfg.Server.TLSCertPath, app.cfg.Server.TLSKeyPath, r) } } else { log.Info("Serving on http://%s:%d\n", bindAddress, app.cfg.Server.Port) log.Info("---") err = http.ListenAndServe(fmt.Sprintf("%s:%d", bindAddress, app.cfg.Server.Port), r) } if err != nil { log.Error("Unable to start: %v", err) os.Exit(1) } } func (app *App) InitDecoder() { // TODO: do this at the package level, instead of the App level // Initialize modules app.formDecoder = schema.NewDecoder() app.formDecoder.RegisterConverter(converter.NullJSONString{}, converter.ConvertJSONNullString) app.formDecoder.RegisterConverter(converter.NullJSONBool{}, converter.ConvertJSONNullBool) app.formDecoder.RegisterConverter(sql.NullString{}, converter.ConvertSQLNullString) app.formDecoder.RegisterConverter(sql.NullBool{}, converter.ConvertSQLNullBool) app.formDecoder.RegisterConverter(sql.NullInt64{}, converter.ConvertSQLNullInt64) app.formDecoder.RegisterConverter(sql.NullFloat64{}, converter.ConvertSQLNullFloat64) } // ConnectToDatabase validates and connects to the configured database, then // tests the connection. func ConnectToDatabase(app *App) error { // Check database configuration if app.cfg.Database.Type == driverMySQL && (app.cfg.Database.User == "" || app.cfg.Database.Password == "") { return fmt.Errorf("Database user or password not set.") } if app.cfg.Database.Host == "" { app.cfg.Database.Host = "localhost" } if app.cfg.Database.Database == "" { app.cfg.Database.Database = "writefreely" } // TODO: check err connectToDatabase(app) // Test database connection err := app.db.Ping() if err != nil { return fmt.Errorf("Database ping failed: %s", err) } return nil } +// FormatVersion constructs the version string for the application +func FormatVersion() string { + return serverSoftware + " " + softwareVer +} + // OutputVersion prints out the version of the application. func OutputVersion() { - fmt.Println(serverSoftware + " " + softwareVer) + fmt.Println(FormatVersion()) } // NewApp creates a new app instance. func NewApp(cfgFile string) *App { return &App{ cfgFile: cfgFile, } } // CreateConfig creates a default configuration and saves it to the app's cfgFile. func CreateConfig(app *App) error { log.Info("Creating configuration...") c := config.New() log.Info("Saving configuration %s...", app.cfgFile) err := config.Save(c, app.cfgFile) if err != nil { return fmt.Errorf("Unable to save configuration: %v", err) } return nil } // DoConfig runs the interactive configuration process. func DoConfig(app *App, configSections string) { if configSections == "" { configSections = "server db app" } // let's check there aren't any garbage in the list configSectionsArray := strings.Split(configSections, " ") for _, element := range configSectionsArray { if element != "server" && element != "db" && element != "app" { log.Error("Invalid argument to --sections. Valid arguments are only \"server\", \"db\" and \"app\"") os.Exit(1) } } d, err := config.Configure(app.cfgFile, configSections) if err != nil { log.Error("Unable to configure: %v", err) os.Exit(1) } app.cfg = d.Config connectToDatabase(app) defer shutdown(app) if !app.db.DatabaseInitialized() { err = adminInitDatabase(app) if err != nil { log.Error(err.Error()) os.Exit(1) } } else { log.Info("Database already initialized.") } if d.User != nil { u := &User{ Username: d.User.Username, HashedPass: d.User.HashedPass, Created: time.Now().Truncate(time.Second).UTC(), } // Create blog log.Info("Creating user %s...\n", u.Username) err = app.db.CreateUser(app.cfg, u, app.cfg.App.SiteName) if err != nil { log.Error("Unable to create user: %s", err) os.Exit(1) } log.Info("Done!") } os.Exit(0) } // GenerateKeyFiles creates app encryption keys and saves them into the configured KeysParentDir. func GenerateKeyFiles(app *App) error { // Read keys path from config app.LoadConfig() // Create keys dir if it doesn't exist yet fullKeysDir := filepath.Join(app.cfg.Server.KeysParentDir, keysDir) if _, err := os.Stat(fullKeysDir); os.IsNotExist(err) { err = os.Mkdir(fullKeysDir, 0700) if err != nil { return err } } // Generate keys initKeyPaths(app) // TODO: use something like https://github.com/hashicorp/go-multierror to return errors var keyErrs error err := generateKey(emailKeyPath) if err != nil { keyErrs = err } err = generateKey(cookieAuthKeyPath) if err != nil { keyErrs = err } err = generateKey(cookieKeyPath) if err != nil { keyErrs = err } return keyErrs } // CreateSchema creates all database tables needed for the application. func CreateSchema(apper Apper) error { apper.LoadConfig() connectToDatabase(apper.App()) defer shutdown(apper.App()) err := adminInitDatabase(apper.App()) if err != nil { return err } return nil } // Migrate runs all necessary database migrations. func Migrate(apper Apper) error { apper.LoadConfig() connectToDatabase(apper.App()) defer shutdown(apper.App()) err := migrations.Migrate(migrations.NewDatastore(apper.App().db.DB, apper.App().db.driverName)) if err != nil { return fmt.Errorf("migrate: %s", err) } return nil } // ResetPassword runs the interactive password reset process. func ResetPassword(apper Apper, username string) error { // Connect to the database apper.LoadConfig() connectToDatabase(apper.App()) defer shutdown(apper.App()) // Fetch user u, err := apper.App().db.GetUserForAuth(username) if err != nil { log.Error("Get user: %s", err) os.Exit(1) } // Prompt for new password prompt := promptui.Prompt{ Templates: &promptui.PromptTemplates{ Success: "{{ . | bold | faint }}: ", }, Label: "New password", Mask: '*', } newPass, err := prompt.Run() if err != nil { log.Error("%s", err) os.Exit(1) } // Do the update log.Info("Updating...") err = adminResetPassword(apper.App(), u, newPass) if err != nil { log.Error("%s", err) os.Exit(1) } log.Info("Success.") return nil } func connectToDatabase(app *App) { log.Info("Connecting to %s database...", app.cfg.Database.Type) var db *sql.DB var err error if app.cfg.Database.Type == driverMySQL { db, err = sql.Open(app.cfg.Database.Type, fmt.Sprintf("%s:%s@tcp(%s:%d)/%s?charset=utf8mb4&parseTime=true&loc=%s", app.cfg.Database.User, app.cfg.Database.Password, app.cfg.Database.Host, app.cfg.Database.Port, app.cfg.Database.Database, url.QueryEscape(time.Local.String()))) db.SetMaxOpenConns(50) } else if app.cfg.Database.Type == driverSQLite { if !SQLiteEnabled { log.Error("Invalid database type '%s'. Binary wasn't compiled with SQLite3 support.", app.cfg.Database.Type) os.Exit(1) } if app.cfg.Database.FileName == "" { log.Error("SQLite database filename value in config.ini is empty.") os.Exit(1) } db, err = sql.Open("sqlite3_with_regex", app.cfg.Database.FileName+"?parseTime=true&cached=shared") db.SetMaxOpenConns(1) } else { log.Error("Invalid database type '%s'. Only 'mysql' and 'sqlite3' are supported right now.", app.cfg.Database.Type) os.Exit(1) } if err != nil { log.Error("%s", err) os.Exit(1) } app.db = &datastore{db, app.cfg.Database.Type} } func shutdown(app *App) { log.Info("Closing database connection...") app.db.Close() } // CreateUser creates a new admin or normal user from the given credentials. func CreateUser(apper Apper, username, password string, isAdmin bool) error { // Create an admin user with --create-admin apper.LoadConfig() connectToDatabase(apper.App()) defer shutdown(apper.App()) // Ensure an admin / first user doesn't already exist firstUser, _ := apper.App().db.GetUserByID(1) if isAdmin { // Abort if trying to create admin user, but one already exists if firstUser != nil { return fmt.Errorf("Admin user already exists (%s). Create a regular user with: writefreely --create-user", firstUser.Username) } } else { // Abort if trying to create regular user, but no admin exists yet if firstUser == nil { return fmt.Errorf("No admin user exists yet. Create an admin first with: writefreely --create-admin") } } // Create the user // Normalize and validate username desiredUsername := username username = getSlug(username, "") usernameDesc := username if username != desiredUsername { usernameDesc += " (originally: " + desiredUsername + ")" } if !author.IsValidUsername(apper.App().cfg, username) { return fmt.Errorf("Username %s is invalid, reserved, or shorter than configured minimum length (%d characters).", usernameDesc, apper.App().cfg.App.MinUsernameLen) } // Hash the password hashedPass, err := auth.HashPass([]byte(password)) if err != nil { return fmt.Errorf("Unable to hash password: %v", err) } u := &User{ Username: username, HashedPass: hashedPass, Created: time.Now().Truncate(time.Second).UTC(), } userType := "user" if isAdmin { userType = "admin" } log.Info("Creating %s %s...", userType, usernameDesc) err = apper.App().db.CreateUser(apper.App().Config(), u, desiredUsername) if err != nil { return fmt.Errorf("Unable to create user: %s", err) } log.Info("Done!") return nil } func adminInitDatabase(app *App) error { schemaFileName := "schema.sql" if app.cfg.Database.Type == driverSQLite { schemaFileName = "sqlite.sql" } schema, err := Asset(schemaFileName) if err != nil { return fmt.Errorf("Unable to load schema file: %v", err) } tblReg := regexp.MustCompile("CREATE TABLE (IF NOT EXISTS )?`([a-z_]+)`") queries := strings.Split(string(schema), ";\n") for _, q := range queries { if strings.TrimSpace(q) == "" { continue } parts := tblReg.FindStringSubmatch(q) if len(parts) >= 3 { log.Info("Creating table %s...", parts[2]) } else { log.Info("Creating table ??? (Weird query) No match in: %v", parts) } _, err = app.db.Exec(q) if err != nil { log.Error("%s", err) } else { log.Info("Created.") } } // Set up migrations table log.Info("Initializing appmigrations table...") err = migrations.SetInitialMigrations(migrations.NewDatastore(app.db.DB, app.db.driverName)) if err != nil { return fmt.Errorf("Unable to set initial migrations: %v", err) } log.Info("Running migrations...") err = migrations.Migrate(migrations.NewDatastore(app.db.DB, app.db.driverName)) if err != nil { return fmt.Errorf("migrate: %s", err) } log.Info("Done.") return nil } diff --git a/cmd/writefreely/main.go b/cmd/writefreely/main.go index 10cd7d6..48993c7 100644 --- a/cmd/writefreely/main.go +++ b/cmd/writefreely/main.go @@ -1,145 +1,146 @@ /* * Copyright © 2018-2019 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package main import ( "flag" "fmt" "github.com/gorilla/mux" "github.com/writeas/web-core/log" "github.com/writeas/writefreely" "os" "strings" ) func main() { // General options usable with other commands debugPtr := flag.Bool("debug", false, "Enables debug logging.") configFile := flag.String("c", "config.ini", "The configuration file to use") // Setup actions createConfig := flag.Bool("create-config", false, "Creates a basic configuration and exits") doConfig := flag.Bool("config", false, "Run the configuration process") configSections := flag.String("sections", "server db app", "Which sections of the configuration to go through (requires --config), "+ "valid values are any combination of 'server', 'db' and 'app' "+ "example: writefreely --config --sections \"db app\"") genKeys := flag.Bool("gen-keys", false, "Generate encryption and authentication keys") createSchema := flag.Bool("init-db", false, "Initialize app database") migrate := flag.Bool("migrate", false, "Migrate the database") // Admin actions createAdmin := flag.String("create-admin", "", "Create an admin with the given username:password") createUser := flag.String("create-user", "", "Create a regular user with the given username:password") resetPassUser := flag.String("reset-pass", "", "Reset the given user's password") outputVersion := flag.Bool("v", false, "Output the current version") flag.Parse() app := writefreely.NewApp(*configFile) if *outputVersion { writefreely.OutputVersion() os.Exit(0) } else if *createConfig { err := writefreely.CreateConfig(app) if err != nil { log.Error(err.Error()) os.Exit(1) } os.Exit(0) } else if *doConfig { writefreely.DoConfig(app, *configSections) os.Exit(0) } else if *genKeys { err := writefreely.GenerateKeyFiles(app) if err != nil { log.Error(err.Error()) os.Exit(1) } os.Exit(0) } else if *createSchema { err := writefreely.CreateSchema(app) if err != nil { log.Error(err.Error()) os.Exit(1) } os.Exit(0) } else if *createAdmin != "" { username, password, err := userPass(*createAdmin, true) if err != nil { log.Error(err.Error()) os.Exit(1) } err = writefreely.CreateUser(app, username, password, true) if err != nil { log.Error(err.Error()) os.Exit(1) } os.Exit(0) } else if *createUser != "" { username, password, err := userPass(*createUser, false) if err != nil { log.Error(err.Error()) os.Exit(1) } err = writefreely.CreateUser(app, username, password, false) if err != nil { log.Error(err.Error()) os.Exit(1) } os.Exit(0) } else if *resetPassUser != "" { err := writefreely.ResetPassword(app, *resetPassUser) if err != nil { log.Error(err.Error()) os.Exit(1) } os.Exit(0) } else if *migrate { err := writefreely.Migrate(app) if err != nil { log.Error(err.Error()) os.Exit(1) } os.Exit(0) } // Initialize the application var err error + log.Info("Starting %s...", writefreely.FormatVersion()) app, err = writefreely.Initialize(app, *debugPtr) if err != nil { log.Error("%s", err) os.Exit(1) } // Set app routes r := mux.NewRouter() writefreely.InitRoutes(app, r) app.InitStaticRoutes(r) // Serve the application writefreely.Serve(app, r) } func userPass(credStr string, isAdmin bool) (user string, pass string, err error) { creds := strings.Split(credStr, ":") if len(creds) != 2 { c := "user" if isAdmin { c = "admin" } err = fmt.Errorf("usage: writefreely --create-%s username:password", c) return } user = creds[0] pass = creds[1] return } diff --git a/collections.go b/collections.go index 4eb5606..3ea859f 100644 --- a/collections.go +++ b/collections.go @@ -1,1086 +1,1088 @@ /* * Copyright © 2018 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "database/sql" "encoding/json" "fmt" "html/template" "math" "net/http" "net/url" "regexp" "strconv" "strings" "unicode" "github.com/gorilla/mux" "github.com/writeas/impart" "github.com/writeas/web-core/activitystreams" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/bots" "github.com/writeas/web-core/log" waposts "github.com/writeas/web-core/posts" "github.com/writeas/writefreely/author" "github.com/writeas/writefreely/config" "github.com/writeas/writefreely/page" ) type ( // TODO: add Direction to db // TODO: add Language to db Collection struct { ID int64 `datastore:"id" json:"-"` Alias string `datastore:"alias" schema:"alias" json:"alias"` Title string `datastore:"title" schema:"title" json:"title"` Description string `datastore:"description" schema:"description" json:"description"` Direction string `schema:"dir" json:"dir,omitempty"` Language string `schema:"lang" json:"lang,omitempty"` StyleSheet string `datastore:"style_sheet" schema:"style_sheet" json:"style_sheet"` Script string `datastore:"script" schema:"script" json:"script,omitempty"` Public bool `datastore:"public" json:"public"` Visibility collVisibility `datastore:"private" json:"-"` Format string `datastore:"format" json:"format,omitempty"` Views int64 `json:"views"` OwnerID int64 `datastore:"owner_id" json:"-"` PublicOwner bool `datastore:"public_owner" json:"-"` URL string `json:"url,omitempty"` db *datastore hostName string } CollectionObj struct { Collection TotalPosts int `json:"total_posts"` Owner *User `json:"owner,omitempty"` Posts *[]PublicPost `json:"posts,omitempty"` } DisplayCollection struct { *CollectionObj Prefix string IsTopLevel bool CurrentPage int TotalPages int Format *CollectionFormat } SubmittedCollection struct { // Data used for updating a given collection ID int64 OwnerID uint64 // Form helpers PreferURL string `schema:"prefer_url" json:"prefer_url"` Privacy int `schema:"privacy" json:"privacy"` Pass string `schema:"password" json:"password"` MathJax bool `schema:"mathjax" json:"mathjax"` Handle string `schema:"handle" json:"handle"` // Actual collection values updated in the DB Alias *string `schema:"alias" json:"alias"` Title *string `schema:"title" json:"title"` Description *string `schema:"description" json:"description"` StyleSheet *sql.NullString `schema:"style_sheet" json:"style_sheet"` Script *sql.NullString `schema:"script" json:"script"` Visibility *int `schema:"visibility" json:"public"` Format *sql.NullString `schema:"format" json:"format"` } CollectionFormat struct { Format string } collectionReq struct { // Information about the collection request itself prefix, alias, domain string isCustomDomain bool // User-related fields isCollOwner bool } ) func (sc *SubmittedCollection) FediverseHandle() string { if sc.Handle == "" { return apCustomHandleDefault } return getSlug(sc.Handle, "") } // collVisibility represents the visibility level for the collection. type collVisibility int // Visibility levels. Values are bitmasks, stored in the database as // decimal numbers. If adding types, append them to this list. If removing, // replace the desired visibility with a new value. const CollUnlisted collVisibility = 0 const ( CollPublic collVisibility = 1 << iota CollPrivate CollProtected ) var collVisibilityStrings = map[string]collVisibility{ "unlisted": CollUnlisted, "public": CollPublic, "private": CollPrivate, "protected": CollProtected, } func defaultVisibility(cfg *config.Config) collVisibility { vis, ok := collVisibilityStrings[cfg.App.DefaultVisibility] if !ok { vis = CollUnlisted } return vis } func (cf *CollectionFormat) Ascending() bool { return cf.Format == "novel" } func (cf *CollectionFormat) ShowDates() bool { return cf.Format == "blog" } func (cf *CollectionFormat) PostsPerPage() int { if cf.Format == "novel" { return postsPerPage } return postsPerPage } // Valid returns whether or not a format value is valid. func (cf *CollectionFormat) Valid() bool { return cf.Format == "blog" || cf.Format == "novel" || cf.Format == "notebook" } // NewFormat creates a new CollectionFormat object from the Collection. func (c *Collection) NewFormat() *CollectionFormat { cf := &CollectionFormat{Format: c.Format} // Fill in default format if cf.Format == "" { cf.Format = "blog" } return cf } func (c *Collection) IsUnlisted() bool { return c.Visibility == 0 } func (c *Collection) IsPrivate() bool { return c.Visibility&CollPrivate != 0 } func (c *Collection) IsProtected() bool { return c.Visibility&CollProtected != 0 } func (c *Collection) IsPublic() bool { return c.Visibility&CollPublic != 0 } func (c *Collection) FriendlyVisibility() string { if c.IsPrivate() { return "Private" } if c.IsPublic() { return "Public" } if c.IsProtected() { return "Password-protected" } return "Unlisted" } func (c *Collection) ShowFooterBranding() bool { // TODO: implement this setting return true } // CanonicalURL returns a fully-qualified URL to the collection. func (c *Collection) CanonicalURL() string { return c.RedirectingCanonicalURL(false) } func (c *Collection) DisplayCanonicalURL() string { us := c.CanonicalURL() u, err := url.Parse(us) if err != nil { return us } p := u.Path if p == "/" { p = "" } return u.Hostname() + p } func (c *Collection) RedirectingCanonicalURL(isRedir bool) string { if c.hostName == "" { // If this is true, the human programmers screwed up. So ask for a bug report and fail, fail, fail log.Error("[PROGRAMMER ERROR] WARNING: Collection.hostName is empty! Federation and many other things will fail! If you're seeing this in the wild, please report this bug and let us know what you were doing just before this: https://github.com/writeas/writefreely/issues/new?template=bug_report.md") } if isSingleUser { return c.hostName + "/" } return fmt.Sprintf("%s/%s/", c.hostName, c.Alias) } // PrevPageURL provides a full URL for the previous page of collection posts, // returning a /page/N result for pages >1 func (c *Collection) PrevPageURL(prefix string, n int, tl bool) string { u := "" if n == 2 { // Previous page is 1; no need for /page/ prefix if prefix == "" { u = "/" } // Else leave off trailing slash } else { u = fmt.Sprintf("/page/%d", n-1) } if tl { return u } return "/" + prefix + c.Alias + u } // NextPageURL provides a full URL for the next page of collection posts func (c *Collection) NextPageURL(prefix string, n int, tl bool) string { if tl { return fmt.Sprintf("/page/%d", n+1) } return fmt.Sprintf("/%s%s/page/%d", prefix, c.Alias, n+1) } func (c *Collection) DisplayTitle() string { if c.Title != "" { return c.Title } return c.Alias } func (c *Collection) StyleSheetDisplay() template.CSS { return template.CSS(c.StyleSheet) } // ForPublic modifies the Collection for public consumption, such as via // the API. func (c *Collection) ForPublic() { c.URL = c.CanonicalURL() } var isAvatarChar = regexp.MustCompile("[a-z0-9]").MatchString func (c *Collection) PersonObject(ids ...int64) *activitystreams.Person { accountRoot := c.FederatedAccount() p := activitystreams.NewPerson(accountRoot) p.URL = c.CanonicalURL() uname := c.Alias p.PreferredUsername = uname p.Name = c.DisplayTitle() p.Summary = c.Description if p.Name != "" { if av := c.AvatarURL(); av != "" { p.Icon = activitystreams.Image{ Type: "Image", MediaType: "image/png", URL: av, } } } collID := c.ID if len(ids) > 0 { collID = ids[0] } pub, priv := c.db.GetAPActorKeys(collID) if pub != nil { p.AddPubKey(pub) p.SetPrivKey(priv) } return p } func (c *Collection) AvatarURL() string { fl := string(unicode.ToLower([]rune(c.DisplayTitle())[0])) if !isAvatarChar(fl) { return "" } return c.hostName + "/img/avatars/" + fl + ".png" } func (c *Collection) FederatedAPIBase() string { return c.hostName + "/" } func (c *Collection) FederatedAccount() string { accountUser := c.Alias return c.FederatedAPIBase() + "api/collections/" + accountUser } func (c *Collection) RenderMathJax() bool { return c.db.CollectionHasAttribute(c.ID, "render_mathjax") } func newCollection(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r.Header.Get("Content-Type")) alias := r.FormValue("alias") title := r.FormValue("title") var missingParams, accessToken string var u *User c := struct { Alias string `json:"alias" schema:"alias"` Title string `json:"title" schema:"title"` Web bool `json:"web" schema:"web"` }{} if reqJSON { // Decode JSON request decoder := json.NewDecoder(r.Body) err := decoder.Decode(&c) if err != nil { log.Error("Couldn't parse post update JSON request: %v\n", err) return ErrBadJSON } } else { // TODO: move form parsing to formDecoder c.Alias = alias c.Title = title } if c.Alias == "" { if c.Title != "" { // If only a title was given, just use it to generate the alias. c.Alias = getSlug(c.Title, "") } else { missingParams += "`alias` " } } if c.Title == "" { missingParams += "`title` " } if missingParams != "" { return impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Parameter(s) %srequired.", missingParams)} } var userID int64 if reqJSON && !c.Web { accessToken = r.Header.Get("Authorization") if accessToken == "" { return ErrNoAccessToken } userID = app.db.GetUserID(accessToken) if userID == -1 { return ErrBadAccessToken } } else { u = getUserSession(app, r) if u == nil { return ErrNotLoggedIn } userID = u.ID } if !author.IsValidUsername(app.cfg, c.Alias) { return impart.HTTPError{http.StatusPreconditionFailed, "Collection alias isn't valid."} } coll, err := app.db.CreateCollection(app.cfg, c.Alias, c.Title, userID) if err != nil { // TODO: handle this return err } res := &CollectionObj{Collection: *coll} if reqJSON { return impart.WriteSuccess(w, res, http.StatusCreated) } redirectTo := "/me/c/" // TODO: redirect to pad when necessary return impart.HTTPError{http.StatusFound, redirectTo} } func apiCheckCollectionPermissions(app *App, r *http.Request, c *Collection) (int64, error) { accessToken := r.Header.Get("Authorization") var userID int64 = -1 if accessToken != "" { userID = app.db.GetUserID(accessToken) } isCollOwner := userID == c.OwnerID if c.IsPrivate() && !isCollOwner { // Collection is private, but user isn't authenticated return -1, ErrCollectionNotFound } if c.IsProtected() { // TODO: check access token return -1, ErrCollectionUnauthorizedRead } return userID, nil } // fetchCollection handles the API endpoint for retrieving collection data. func fetchCollection(app *App, w http.ResponseWriter, r *http.Request) error { accept := r.Header.Get("Accept") if strings.Contains(accept, "application/activity+json") { return handleFetchCollectionActivities(app, w, r) } vars := mux.Vars(r) alias := vars["alias"] // TODO: move this logic into a common getCollection function // Get base Collection data c, err := app.db.GetCollection(alias) if err != nil { return err } c.hostName = app.cfg.App.Host // Redirect users who aren't requesting JSON reqJSON := IsJSON(r.Header.Get("Content-Type")) if !reqJSON { return impart.HTTPError{http.StatusFound, c.CanonicalURL()} } // Check permissions userID, err := apiCheckCollectionPermissions(app, r, c) if err != nil { return err } isCollOwner := userID == c.OwnerID // Fetch extra data about the Collection res := &CollectionObj{Collection: *c} if c.PublicOwner { u, err := app.db.GetUserByID(res.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } else { res.Owner = u } } app.db.GetPostsCount(res, isCollOwner) // Strip non-public information res.Collection.ForPublic() return impart.WriteSuccess(w, res, http.StatusOK) } // fetchCollectionPosts handles an API endpoint for retrieving a collection's // posts. func fetchCollectionPosts(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) alias := vars["alias"] c, err := app.db.GetCollection(alias) if err != nil { return err } c.hostName = app.cfg.App.Host // Check permissions userID, err := apiCheckCollectionPermissions(app, r, c) if err != nil { return err } isCollOwner := userID == c.OwnerID // Get page page := 1 if p := r.FormValue("page"); p != "" { pInt, _ := strconv.Atoi(p) if pInt > 0 { page = pInt } } posts, err := app.db.GetPosts(app.cfg, c, page, isCollOwner, false, false) if err != nil { return err } coll := &CollectionObj{Collection: *c, Posts: posts} app.db.GetPostsCount(coll, isCollOwner) // Strip non-public information coll.Collection.ForPublic() // Transform post bodies if needed if r.FormValue("body") == "html" { for _, p := range *coll.Posts { p.Content = waposts.ApplyMarkdown([]byte(p.Content)) } } return impart.WriteSuccess(w, coll, http.StatusOK) } type CollectionPage struct { page.StaticPage *DisplayCollection IsCustomDomain bool IsWelcome bool IsOwner bool CanPin bool Username string Collections *[]Collection PinnedPosts *[]PublicPost IsAdmin bool CanInvite bool } func (c *CollectionObj) ScriptDisplay() template.JS { return template.JS(c.Script) } var jsSourceCommentReg = regexp.MustCompile("(?m)^// src:(.+)$") func (c *CollectionObj) ExternalScripts() []template.URL { scripts := []template.URL{} if c.Script == "" { return scripts } matches := jsSourceCommentReg.FindAllStringSubmatch(c.Script, -1) for _, m := range matches { scripts = append(scripts, template.URL(strings.TrimSpace(m[1]))) } return scripts } func (c *CollectionObj) CanShowScript() bool { return false } func processCollectionRequest(cr *collectionReq, vars map[string]string, w http.ResponseWriter, r *http.Request) error { cr.prefix = vars["prefix"] cr.alias = vars["collection"] // Normalize the URL, redirecting user to consistent post URL if cr.alias != strings.ToLower(cr.alias) { return impart.HTTPError{http.StatusMovedPermanently, fmt.Sprintf("/%s/", strings.ToLower(cr.alias))} } return nil } // processCollectionPermissions checks the permissions for the given // collectionReq, returning a Collection if access is granted; otherwise this // renders any necessary collection pages, for example, if requesting a custom // domain that doesn't yet have a collection associated, or if a collection // requires a password. In either case, this will return nil, nil -- thus both // values should ALWAYS be checked to determine whether or not to continue. func processCollectionPermissions(app *App, cr *collectionReq, u *User, w http.ResponseWriter, r *http.Request) (*Collection, error) { // Display collection if this is a collection var c *Collection var err error if app.cfg.App.SingleUser { c, err = app.db.GetCollectionByID(1) } else { c, err = app.db.GetCollection(cr.alias) } // TODO: verify we don't reveal the existence of a private collection with redirection if err != nil { if err, ok := err.(impart.HTTPError); ok { if err.Status == http.StatusNotFound { if cr.isCustomDomain { // User is on the site from a custom domain //tErr := pages["404-domain.tmpl"].ExecuteTemplate(w, "base", pageForHost(page.StaticPage{}, r)) //if tErr != nil { //log.Error("Unable to render 404-domain page: %v", err) //} return nil, nil } if len(cr.alias) >= minIDLen && len(cr.alias) <= maxIDLen { // Alias is within post ID range, so just be sure this isn't a post if app.db.PostIDExists(cr.alias) { // TODO: use StatusFound for vanity post URLs when we implement them return nil, impart.HTTPError{http.StatusMovedPermanently, "/" + cr.alias} } } // Redirect if necessary newAlias := app.db.GetCollectionRedirect(cr.alias) if newAlias != "" { return nil, impart.HTTPError{http.StatusFound, "/" + newAlias + "/"} } } } return nil, err } c.hostName = app.cfg.App.Host // Update CollectionRequest to reflect owner status cr.isCollOwner = u != nil && u.ID == c.OwnerID // Check permissions if !cr.isCollOwner { if c.IsPrivate() { return nil, ErrCollectionNotFound } else if c.IsProtected() { uname := "" if u != nil { uname = u.Username } // See if we've authorized this collection authd := isAuthorizedForCollection(app, c.Alias, r) if !authd { p := struct { page.StaticPage *CollectionObj Username string Next string Flashes []template.HTML }{ StaticPage: pageForReq(app, r), CollectionObj: &CollectionObj{Collection: *c}, Username: uname, Next: r.FormValue("g"), Flashes: []template.HTML{}, } // Get owner information p.CollectionObj.Owner, err = app.db.GetUserByID(c.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } flashes, _ := getSessionFlashes(app, w, r, nil) for _, flash := range flashes { p.Flashes = append(p.Flashes, template.HTML(flash)) } err = templates["password-collection"].ExecuteTemplate(w, "password-collection", p) if err != nil { log.Error("Unable to render password-collection: %v", err) return nil, err } return nil, nil } } } return c, nil } func checkUserForCollection(app *App, cr *collectionReq, r *http.Request, isPostReq bool) (*User, error) { u := getUserSession(app, r) return u, nil } func newDisplayCollection(c *Collection, cr *collectionReq, page int) *DisplayCollection { coll := &DisplayCollection{ CollectionObj: &CollectionObj{Collection: *c}, CurrentPage: page, Prefix: cr.prefix, IsTopLevel: isSingleUser, Format: c.NewFormat(), } c.db.GetPostsCount(coll.CollectionObj, cr.isCollOwner) return coll } func getCollectionPage(vars map[string]string) int { page := 1 var p int p, _ = strconv.Atoi(vars["page"]) if p > 0 { page = p } return page } // handleViewCollection displays the requested Collection func handleViewCollection(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) cr := &collectionReq{} err := processCollectionRequest(cr, vars, w, r) if err != nil { return err } u, err := checkUserForCollection(app, cr, r, false) if err != nil { return err } page := getCollectionPage(vars) c, err := processCollectionPermissions(app, cr, u, w, r) if c == nil || err != nil { return err } + c.hostName = app.cfg.App.Host + // Serve ActivityStreams data now, if requested if strings.Contains(r.Header.Get("Accept"), "application/activity+json") { ac := c.PersonObject() ac.Context = []interface{}{activitystreams.Namespace} return impart.RenderActivityJSON(w, ac, http.StatusOK) } // Fetch extra data about the Collection // TODO: refactor out this logic, shared in collection.go:fetchCollection() coll := newDisplayCollection(c, cr, page) coll.TotalPages = int(math.Ceil(float64(coll.TotalPosts) / float64(coll.Format.PostsPerPage()))) if coll.TotalPages > 0 && page > coll.TotalPages { redirURL := fmt.Sprintf("/page/%d", coll.TotalPages) if !app.cfg.App.SingleUser { redirURL = fmt.Sprintf("/%s%s%s", cr.prefix, coll.Alias, redirURL) } return impart.HTTPError{http.StatusFound, redirURL} } coll.Posts, _ = app.db.GetPosts(app.cfg, c, page, cr.isCollOwner, false, false) // Serve collection displayPage := CollectionPage{ DisplayCollection: coll, StaticPage: pageForReq(app, r), IsCustomDomain: cr.isCustomDomain, IsWelcome: r.FormValue("greeting") != "", } displayPage.IsAdmin = u != nil && u.IsAdmin() displayPage.CanInvite = canUserInvite(app.cfg, displayPage.IsAdmin) var owner *User if u != nil { displayPage.Username = u.Username displayPage.IsOwner = u.ID == coll.OwnerID if displayPage.IsOwner { // Add in needed information for users viewing their own collection owner = u displayPage.CanPin = true - pubColls, err := app.db.GetPublishableCollections(owner) + pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) } displayPage.Collections = pubColls } } if owner == nil { // Current user doesn't own collection; retrieve owner information owner, err = app.db.GetUserByID(coll.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } } displayPage.Owner = owner coll.Owner = displayPage.Owner // Add more data // TODO: fix this mess of collections inside collections displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj) collTmpl := "collection" if app.cfg.App.Chorus { collTmpl = "chorus-collection" } err = templates[collTmpl].ExecuteTemplate(w, "collection", displayPage) if err != nil { log.Error("Unable to render collection index: %v", err) } // Update collection view count go func() { // Don't update if owner is viewing the collection. if u != nil && u.ID == coll.OwnerID { return } // Only update for human views if r.Method == "HEAD" || bots.IsBot(r.UserAgent()) { return } _, err := app.db.Exec("UPDATE collections SET view_count = view_count + 1 WHERE id = ?", coll.ID) if err != nil { log.Error("Unable to update collections count: %v", err) } }() return err } func handleViewCollectionTag(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) tag := vars["tag"] cr := &collectionReq{} err := processCollectionRequest(cr, vars, w, r) if err != nil { return err } u, err := checkUserForCollection(app, cr, r, false) if err != nil { return err } page := getCollectionPage(vars) c, err := processCollectionPermissions(app, cr, u, w, r) if c == nil || err != nil { return err } coll := newDisplayCollection(c, cr, page) coll.Posts, _ = app.db.GetPostsTagged(app.cfg, c, tag, page, cr.isCollOwner) if coll.Posts != nil && len(*coll.Posts) == 0 { return ErrCollectionPageNotFound } // Serve collection displayPage := struct { CollectionPage Tag string }{ CollectionPage: CollectionPage{ DisplayCollection: coll, StaticPage: pageForReq(app, r), IsCustomDomain: cr.isCustomDomain, }, Tag: tag, } var owner *User if u != nil { displayPage.Username = u.Username displayPage.IsOwner = u.ID == coll.OwnerID if displayPage.IsOwner { // Add in needed information for users viewing their own collection owner = u displayPage.CanPin = true - pubColls, err := app.db.GetPublishableCollections(owner) + pubColls, err := app.db.GetPublishableCollections(owner, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) } displayPage.Collections = pubColls } } if owner == nil { // Current user doesn't own collection; retrieve owner information owner, err = app.db.GetUserByID(coll.OwnerID) if err != nil { // Log the error and just continue log.Error("Error getting user for collection: %v", err) } } displayPage.Owner = owner coll.Owner = displayPage.Owner // Add more data // TODO: fix this mess of collections inside collections displayPage.PinnedPosts, _ = app.db.GetPinnedPosts(coll.CollectionObj) err = templates["collection-tags"].ExecuteTemplate(w, "collection-tags", displayPage) if err != nil { log.Error("Unable to render collection tag page: %v", err) } return nil } func handleCollectionPostRedirect(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) slug := vars["slug"] cr := &collectionReq{} err := processCollectionRequest(cr, vars, w, r) if err != nil { return err } // Normalize the URL, redirecting user to consistent post URL loc := fmt.Sprintf("/%s", slug) if !app.cfg.App.SingleUser { loc = fmt.Sprintf("/%s/%s", cr.alias, slug) } return impart.HTTPError{http.StatusFound, loc} } func existingCollection(app *App, w http.ResponseWriter, r *http.Request) error { reqJSON := IsJSON(r.Header.Get("Content-Type")) vars := mux.Vars(r) collAlias := vars["alias"] isWeb := r.FormValue("web") == "1" var u *User if reqJSON && !isWeb { // Ensure an access token was given accessToken := r.Header.Get("Authorization") u = &User{} u.ID = app.db.GetUserID(accessToken) if u.ID == -1 { return ErrBadAccessToken } } else { u = getUserSession(app, r) if u == nil { return ErrNotLoggedIn } } if r.Method == "DELETE" { err := app.db.DeleteCollection(collAlias, u.ID) if err != nil { // TODO: if not HTTPError, report error to admin log.Error("Unable to delete collection: %s", err) return err } addSessionFlash(app, w, r, "Deleted your blog, "+collAlias+".", nil) return impart.HTTPError{Status: http.StatusNoContent} } c := SubmittedCollection{OwnerID: uint64(u.ID)} var err error if reqJSON { // Decode JSON request decoder := json.NewDecoder(r.Body) err = decoder.Decode(&c) if err != nil { log.Error("Couldn't parse collection update JSON request: %v\n", err) return ErrBadJSON } } else { err = r.ParseForm() if err != nil { log.Error("Couldn't parse collection update form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&c, r.PostForm) if err != nil { log.Error("Couldn't decode collection update form request: %v\n", err) return ErrBadFormData } } err = app.db.UpdateCollection(&c, collAlias) if err != nil { if err, ok := err.(impart.HTTPError); ok { if reqJSON { return err } addSessionFlash(app, w, r, err.Message, nil) return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias} } else { log.Error("Couldn't update collection: %v\n", err) return err } } if reqJSON { return impart.WriteSuccess(w, struct { }{}, http.StatusOK) } addSessionFlash(app, w, r, "Blog updated!", nil) return impart.HTTPError{http.StatusFound, "/me/c/" + collAlias} } // collectionAliasFromReq takes a request and returns the collection alias // if it can be ascertained, as well as whether or not the collection uses a // custom domain. func collectionAliasFromReq(r *http.Request) string { vars := mux.Vars(r) alias := vars["subdomain"] isSubdomain := alias != "" if !isSubdomain { // Fall back to write.as/{collection} since this isn't a custom domain alias = vars["collection"] } return alias } func handleWebCollectionUnlock(app *App, w http.ResponseWriter, r *http.Request) error { var readReq struct { Alias string `schema:"alias" json:"alias"` Pass string `schema:"password" json:"password"` Next string `schema:"to" json:"to"` } // Get params if impart.ReqJSON(r) { decoder := json.NewDecoder(r.Body) err := decoder.Decode(&readReq) if err != nil { log.Error("Couldn't parse readReq JSON request: %v\n", err) return ErrBadJSON } } else { err := r.ParseForm() if err != nil { log.Error("Couldn't parse readReq form request: %v\n", err) return ErrBadFormData } err = app.formDecoder.Decode(&readReq, r.PostForm) if err != nil { log.Error("Couldn't decode readReq form request: %v\n", err) return ErrBadFormData } } if readReq.Alias == "" { return impart.HTTPError{http.StatusBadRequest, "Need a collection `alias` to read."} } if readReq.Pass == "" { return impart.HTTPError{http.StatusBadRequest, "Please supply a password."} } var collHashedPass []byte err := app.db.QueryRow("SELECT password FROM collectionpasswords INNER JOIN collections ON id = collection_id WHERE alias = ?", readReq.Alias).Scan(&collHashedPass) if err != nil { if err == sql.ErrNoRows { log.Error("No collectionpassword found when trying to read collection %s", readReq.Alias) return impart.HTTPError{http.StatusInternalServerError, "Something went very wrong. The humans have been alerted."} } return err } if !auth.Authenticated(collHashedPass, []byte(readReq.Pass)) { return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."} } // Success; set cookie session, err := app.sessionStore.Get(r, blogPassCookieName) if err == nil { session.Values[readReq.Alias] = true err = session.Save(r, w) if err != nil { log.Error("Didn't save unlocked blog '%s': %v", readReq.Alias, err) } } next := "/" + readReq.Next if !app.cfg.App.SingleUser { next = "/" + readReq.Alias + next } return impart.HTTPError{http.StatusFound, next} } func isAuthorizedForCollection(app *App, alias string, r *http.Request) bool { authd := false session, err := app.sessionStore.Get(r, blogPassCookieName) if err == nil { _, authd = session.Values[alias] } return authd } diff --git a/database.go b/database.go index 77ae185..6c18d64 100644 --- a/database.go +++ b/database.go @@ -1,2433 +1,2434 @@ /* * Copyright © 2018 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "database/sql" "fmt" "net/http" "strings" "time" "github.com/guregu/null" "github.com/guregu/null/zero" uuid "github.com/nu7hatch/gouuid" "github.com/writeas/impart" "github.com/writeas/nerds/store" "github.com/writeas/web-core/activitypub" "github.com/writeas/web-core/auth" "github.com/writeas/web-core/data" "github.com/writeas/web-core/id" "github.com/writeas/web-core/log" "github.com/writeas/web-core/query" "github.com/writeas/writefreely/author" "github.com/writeas/writefreely/config" "github.com/writeas/writefreely/key" ) const ( mySQLErrDuplicateKey = 1062 driverMySQL = "mysql" driverSQLite = "sqlite3" ) var ( SQLiteEnabled bool ) type writestore interface { CreateUser(*config.Config, *User, string) error UpdateUserEmail(keys *key.Keychain, userID int64, email string) error UpdateEncryptedUserEmail(int64, []byte) error GetUserByID(int64) (*User, error) GetUserForAuth(string) (*User, error) GetUserForAuthByID(int64) (*User, error) GetUserNameFromToken(string) (string, error) GetUserDataFromToken(string) (int64, string, error) GetAPIUser(header string) (*User, error) GetUserID(accessToken string) int64 GetUserIDPrivilege(accessToken string) (userID int64, sudo bool) DeleteToken(accessToken []byte) error FetchLastAccessToken(userID int64) string GetAccessToken(userID int64) (string, error) GetTemporaryAccessToken(userID int64, validSecs int) (string, error) GetTemporaryOneTimeAccessToken(userID int64, validSecs int, oneTime bool) (string, error) DeleteAccount(userID int64) (l *string, err error) ChangeSettings(app *App, u *User, s *userSettings) error ChangePassphrase(userID int64, sudo bool, curPass string, hashedPass []byte) error - GetCollections(u *User) (*[]Collection, error) - GetPublishableCollections(u *User) (*[]Collection, error) + GetCollections(u *User, hostName string) (*[]Collection, error) + GetPublishableCollections(u *User, hostName string) (*[]Collection, error) GetMeStats(u *User) userMeStats GetTotalCollections() (int64, error) GetTotalPosts() (int64, error) GetTopPosts(u *User, alias string) (*[]PublicPost, error) GetAnonymousPosts(u *User) (*[]PublicPost, error) GetUserPosts(u *User) (*[]PublicPost, error) CreateOwnedPost(post *SubmittedPost, accessToken, collAlias, hostName string) (*PublicPost, error) CreatePost(userID, collID int64, post *SubmittedPost) (*Post, error) UpdateOwnedPost(post *AuthenticatedPost, userID int64) error GetEditablePost(id, editToken string) (*PublicPost, error) PostIDExists(id string) bool GetPost(id string, collectionID int64) (*PublicPost, error) GetOwnedPost(id string, ownerID int64) (*PublicPost, error) GetPostProperty(id string, collectionID int64, property string) (interface{}, error) CreateCollectionFromToken(*config.Config, string, string, string) (*Collection, error) CreateCollection(*config.Config, string, string, int64) (*Collection, error) GetCollectionBy(condition string, value interface{}) (*Collection, error) GetCollection(alias string) (*Collection, error) GetCollectionForPad(alias string) (*Collection, error) GetCollectionByID(id int64) (*Collection, error) UpdateCollection(c *SubmittedCollection, alias string) error DeleteCollection(alias string, userID int64) error UpdatePostPinState(pinned bool, postID string, collID, ownerID, pos int64) error GetLastPinnedPostPos(collID int64) int64 GetPinnedPosts(coll *CollectionObj) (*[]PublicPost, error) RemoveCollectionRedirect(t *sql.Tx, alias string) error GetCollectionRedirect(alias string) (new string) IsCollectionAttributeOn(id int64, attr string) bool CollectionHasAttribute(id int64, attr string) bool CanCollect(cpr *ClaimPostRequest, userID int64) bool AttemptClaim(p *ClaimPostRequest, query string, params []interface{}, slugIdx int) (sql.Result, error) DispersePosts(userID int64, postIDs []string) (*[]ClaimPostResult, error) ClaimPosts(cfg *config.Config, userID int64, collAlias string, posts *[]ClaimPostRequest) (*[]ClaimPostResult, error) GetPostsCount(c *CollectionObj, includeFuture bool) GetPosts(cfg *config.Config, c *Collection, page int, includeFuture, forceRecentFirst, includePinned bool) (*[]PublicPost, error) GetPostsTagged(cfg *config.Config, c *Collection, tag string, page int, includeFuture bool) (*[]PublicPost, error) GetAPFollowers(c *Collection) (*[]RemoteUser, error) GetAPActorKeys(collectionID int64) ([]byte, []byte) CreateUserInvite(id string, userID int64, maxUses int, expires *time.Time) error GetUserInvites(userID int64) (*[]Invite, error) GetUserInvite(id string) (*Invite, error) GetUsersInvitedCount(id string) int64 CreateInvitedUser(inviteID string, userID int64) error GetDynamicContent(id string) (*instanceContent, error) UpdateDynamicContent(id, title, content, contentType string) error GetAllUsers(page uint) (*[]User, error) GetAllUsersCount() int64 GetUserLastPostTime(id int64) (*time.Time, error) GetCollectionLastPostTime(id int64) (*time.Time, error) DatabaseInitialized() bool } type datastore struct { *sql.DB driverName string } func (db *datastore) now() string { if db.driverName == driverSQLite { return "strftime('%Y-%m-%d %H:%M:%S','now')" } return "NOW()" } func (db *datastore) clip(field string, l int) string { if db.driverName == driverSQLite { return fmt.Sprintf("SUBSTR(%s, 0, %d)", field, l) } return fmt.Sprintf("LEFT(%s, %d)", field, l) } func (db *datastore) upsert(indexedCols ...string) string { if db.driverName == driverSQLite { // NOTE: SQLite UPSERT syntax only works in v3.24.0 (2018-06-04) or later // Leaving this for whenever we can upgrade and include it in our binary cc := strings.Join(indexedCols, ", ") return "ON CONFLICT(" + cc + ") DO UPDATE SET" } return "ON DUPLICATE KEY UPDATE" } func (db *datastore) dateSub(l int, unit string) string { if db.driverName == driverSQLite { return fmt.Sprintf("DATETIME('now', '-%d %s')", l, unit) } return fmt.Sprintf("DATE_SUB(NOW(), INTERVAL %d %s)", l, unit) } func (db *datastore) CreateUser(cfg *config.Config, u *User, collectionTitle string) error { if db.PostIDExists(u.Username) { return impart.HTTPError{http.StatusConflict, "Invalid collection name."} } // New users get a `users` and `collections` row. t, err := db.Begin() if err != nil { return err } // 1. Add to `users` table // NOTE: Assumes User's Password is already hashed! res, err := t.Exec("INSERT INTO users (username, password, email) VALUES (?, ?, ?)", u.Username, u.HashedPass, u.Email) if err != nil { t.Rollback() if db.isDuplicateKeyErr(err) { return impart.HTTPError{http.StatusConflict, "Username is already taken."} } log.Error("Rolling back users INSERT: %v\n", err) return err } u.ID, err = res.LastInsertId() if err != nil { t.Rollback() log.Error("Rolling back after LastInsertId: %v\n", err) return err } // 2. Create user's Collection if collectionTitle == "" { collectionTitle = u.Username } res, err = t.Exec("INSERT INTO collections (alias, title, description, privacy, owner_id, view_count) VALUES (?, ?, ?, ?, ?, ?)", u.Username, collectionTitle, "", defaultVisibility(cfg), u.ID, 0) if err != nil { t.Rollback() if db.isDuplicateKeyErr(err) { return impart.HTTPError{http.StatusConflict, "Username is already taken."} } log.Error("Rolling back collections INSERT: %v\n", err) return err } db.RemoveCollectionRedirect(t, u.Username) err = t.Commit() if err != nil { t.Rollback() log.Error("Rolling back after Commit(): %v\n", err) return err } return nil } // FIXME: We're returning errors inconsistently in this file. Do we use Errorf // for returned value, or impart? func (db *datastore) UpdateUserEmail(keys *key.Keychain, userID int64, email string) error { encEmail, err := data.Encrypt(keys.EmailKey, email) if err != nil { return fmt.Errorf("Couldn't encrypt email %s: %s\n", email, err) } return db.UpdateEncryptedUserEmail(userID, encEmail) } func (db *datastore) UpdateEncryptedUserEmail(userID int64, encEmail []byte) error { _, err := db.Exec("UPDATE users SET email = ? WHERE id = ?", encEmail, userID) if err != nil { return fmt.Errorf("Unable to update user email: %s", err) } return nil } func (db *datastore) CreateCollectionFromToken(cfg *config.Config, alias, title, accessToken string) (*Collection, error) { userID := db.GetUserID(accessToken) if userID == -1 { return nil, ErrBadAccessToken } return db.CreateCollection(cfg, alias, title, userID) } func (db *datastore) GetUserCollectionCount(userID int64) (uint64, error) { var collCount uint64 err := db.QueryRow("SELECT COUNT(*) FROM collections WHERE owner_id = ?", userID).Scan(&collCount) switch { case err == sql.ErrNoRows: return 0, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user from database."} case err != nil: log.Error("Couldn't get collections count for user %d: %v", userID, err) return 0, err } return collCount, nil } func (db *datastore) CreateCollection(cfg *config.Config, alias, title string, userID int64) (*Collection, error) { if db.PostIDExists(alias) { return nil, impart.HTTPError{http.StatusConflict, "Invalid collection name."} } // All good, so create new collection res, err := db.Exec("INSERT INTO collections (alias, title, description, privacy, owner_id, view_count) VALUES (?, ?, ?, ?, ?, ?)", alias, title, "", defaultVisibility(cfg), userID, 0) if err != nil { if db.isDuplicateKeyErr(err) { return nil, impart.HTTPError{http.StatusConflict, "Collection already exists."} } log.Error("Couldn't add to collections: %v\n", err) return nil, err } c := &Collection{ Alias: alias, Title: title, OwnerID: userID, PublicOwner: false, Public: defaultVisibility(cfg) == CollPublic, } c.ID, err = res.LastInsertId() if err != nil { log.Error("Couldn't get collection LastInsertId: %v\n", err) } return c, nil } func (db *datastore) GetUserByID(id int64) (*User, error) { u := &User{ID: id} err := db.QueryRow("SELECT username, password, email, created FROM users WHERE id = ?", id).Scan(&u.Username, &u.HashedPass, &u.Email, &u.Created) switch { case err == sql.ErrNoRows: return nil, ErrUserNotFound case err != nil: log.Error("Couldn't SELECT user password: %v", err) return nil, err } return u, nil } // DoesUserNeedAuth returns true if the user hasn't provided any methods for // authenticating with the account, such a passphrase or email address. // Any errors are reported to admin and silently quashed, returning false as the // result. func (db *datastore) DoesUserNeedAuth(id int64) bool { var pass, email []byte // Find out if user has an email set first err := db.QueryRow("SELECT password, email FROM users WHERE id = ?", id).Scan(&pass, &email) switch { case err == sql.ErrNoRows: // ERROR. Don't give false positives on needing auth methods return false case err != nil: // ERROR. Don't give false positives on needing auth methods log.Error("Couldn't SELECT user %d from users: %v", id, err) return false } // User doesn't need auth if there's an email return len(email) == 0 && len(pass) == 0 } func (db *datastore) IsUserPassSet(id int64) (bool, error) { var pass []byte err := db.QueryRow("SELECT password FROM users WHERE id = ?", id).Scan(&pass) switch { case err == sql.ErrNoRows: return false, nil case err != nil: log.Error("Couldn't SELECT user %d from users: %v", id, err) return false, err } return len(pass) > 0, nil } func (db *datastore) GetUserForAuth(username string) (*User, error) { u := &User{Username: username} err := db.QueryRow("SELECT id, password, email, created FROM users WHERE username = ?", username).Scan(&u.ID, &u.HashedPass, &u.Email, &u.Created) switch { case err == sql.ErrNoRows: // Check if they've entered the wrong, unnormalized username username = getSlug(username, "") if username != u.Username { err = db.QueryRow("SELECT id FROM users WHERE username = ? LIMIT 1", username).Scan(&u.ID) if err == nil { return db.GetUserForAuth(username) } } return nil, ErrUserNotFound case err != nil: log.Error("Couldn't SELECT user password: %v", err) return nil, err } return u, nil } func (db *datastore) GetUserForAuthByID(userID int64) (*User, error) { u := &User{ID: userID} err := db.QueryRow("SELECT id, password, email, created FROM users WHERE id = ?", u.ID).Scan(&u.ID, &u.HashedPass, &u.Email, &u.Created) switch { case err == sql.ErrNoRows: return nil, ErrUserNotFound case err != nil: log.Error("Couldn't SELECT userForAuthByID: %v", err) return nil, err } return u, nil } func (db *datastore) GetUserNameFromToken(accessToken string) (string, error) { t := auth.GetToken(accessToken) if len(t) == 0 { return "", ErrNoAccessToken } var oneTime bool var username string err := db.QueryRow("SELECT username, one_time FROM accesstokens LEFT JOIN users ON user_id = id WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&username, &oneTime) switch { case err == sql.ErrNoRows: return "", ErrBadAccessToken case err != nil: return "", ErrInternalGeneral } // Delete token if it was one-time if oneTime { db.DeleteToken(t[:]) } return username, nil } func (db *datastore) GetUserDataFromToken(accessToken string) (int64, string, error) { t := auth.GetToken(accessToken) if len(t) == 0 { return 0, "", ErrNoAccessToken } var userID int64 var oneTime bool var username string err := db.QueryRow("SELECT user_id, username, one_time FROM accesstokens LEFT JOIN users ON user_id = id WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&userID, &username, &oneTime) switch { case err == sql.ErrNoRows: return 0, "", ErrBadAccessToken case err != nil: return 0, "", ErrInternalGeneral } // Delete token if it was one-time if oneTime { db.DeleteToken(t[:]) } return userID, username, nil } func (db *datastore) GetAPIUser(header string) (*User, error) { uID := db.GetUserID(header) if uID == -1 { return nil, fmt.Errorf(ErrUserNotFound.Error()) } return db.GetUserByID(uID) } // GetUserID takes a hexadecimal accessToken, parses it into its binary // representation, and gets any user ID associated with the token. If no user // is associated, -1 is returned. func (db *datastore) GetUserID(accessToken string) int64 { i, _ := db.GetUserIDPrivilege(accessToken) return i } func (db *datastore) GetUserIDPrivilege(accessToken string) (userID int64, sudo bool) { t := auth.GetToken(accessToken) if len(t) == 0 { return -1, false } var oneTime bool err := db.QueryRow("SELECT user_id, sudo, one_time FROM accesstokens WHERE token LIKE ? AND (expires IS NULL OR expires > "+db.now()+")", t).Scan(&userID, &sudo, &oneTime) switch { case err == sql.ErrNoRows: return -1, false case err != nil: return -1, false } // Delete token if it was one-time if oneTime { db.DeleteToken(t[:]) } return } func (db *datastore) DeleteToken(accessToken []byte) error { res, err := db.Exec("DELETE FROM accesstokens WHERE token LIKE ?", accessToken) if err != nil { return err } rowsAffected, _ := res.RowsAffected() if rowsAffected == 0 { return impart.HTTPError{http.StatusNotFound, "Token is invalid or doesn't exist"} } return nil } // FetchLastAccessToken creates a new non-expiring, valid access token for the given // userID. func (db *datastore) FetchLastAccessToken(userID int64) string { var t []byte err := db.QueryRow("SELECT token FROM accesstokens WHERE user_id = ? AND (expires IS NULL OR expires > "+db.now()+") ORDER BY created DESC LIMIT 1", userID).Scan(&t) switch { case err == sql.ErrNoRows: return "" case err != nil: log.Error("Failed selecting from accesstoken: %v", err) return "" } u, err := uuid.Parse(t) if err != nil { return "" } return u.String() } // GetAccessToken creates a new non-expiring, valid access token for the given // userID. func (db *datastore) GetAccessToken(userID int64) (string, error) { return db.GetTemporaryOneTimeAccessToken(userID, 0, false) } // GetTemporaryAccessToken creates a new valid access token for the given // userID that remains valid for the given time in seconds. If validSecs is 0, // the access token doesn't automatically expire. func (db *datastore) GetTemporaryAccessToken(userID int64, validSecs int) (string, error) { return db.GetTemporaryOneTimeAccessToken(userID, validSecs, false) } // GetTemporaryOneTimeAccessToken creates a new valid access token for the given // userID that remains valid for the given time in seconds and can only be used // once if oneTime is true. If validSecs is 0, the access token doesn't // automatically expire. func (db *datastore) GetTemporaryOneTimeAccessToken(userID int64, validSecs int, oneTime bool) (string, error) { u, err := uuid.NewV4() if err != nil { log.Error("Unable to generate token: %v", err) return "", err } // Insert UUID to `accesstokens` binTok := u[:] expirationVal := "NULL" if validSecs > 0 { expirationVal = fmt.Sprintf("DATE_ADD("+db.now()+", INTERVAL %d SECOND)", validSecs) } _, err = db.Exec("INSERT INTO accesstokens (token, user_id, one_time, expires) VALUES (?, ?, ?, "+expirationVal+")", string(binTok), userID, oneTime) if err != nil { log.Error("Couldn't INSERT accesstoken: %v", err) return "", err } return u.String(), nil } func (db *datastore) CreateOwnedPost(post *SubmittedPost, accessToken, collAlias, hostName string) (*PublicPost, error) { var userID, collID int64 = -1, -1 var coll *Collection var err error if accessToken != "" { userID = db.GetUserID(accessToken) if userID == -1 { return nil, ErrBadAccessToken } if collAlias != "" { coll, err = db.GetCollection(collAlias) if err != nil { return nil, err } coll.hostName = hostName if coll.OwnerID != userID { return nil, ErrForbiddenCollection } collID = coll.ID } } rp := &PublicPost{} rp.Post, err = db.CreatePost(userID, collID, post) if err != nil { return rp, err } if coll != nil { coll.ForPublic() rp.Collection = &CollectionObj{Collection: *coll} } return rp, nil } func (db *datastore) CreatePost(userID, collID int64, post *SubmittedPost) (*Post, error) { idLen := postIDLen friendlyID := store.GenerateFriendlyRandomString(idLen) // Handle appearance / font face appearance := post.Font if !post.isFontValid() { appearance = "norm" } var err error ownerID := sql.NullInt64{ Valid: false, } ownerCollID := sql.NullInt64{ Valid: false, } slug := sql.NullString{"", false} // If an alias was supplied, we'll add this to the collection as well. if userID > 0 { ownerID.Int64 = userID ownerID.Valid = true if collID > 0 { ownerCollID.Int64 = collID ownerCollID.Valid = true var slugVal string if post.Title != nil && *post.Title != "" { slugVal = getSlug(*post.Title, post.Language.String) if slugVal == "" { slugVal = getSlug(*post.Content, post.Language.String) } } else { slugVal = getSlug(*post.Content, post.Language.String) } if slugVal == "" { slugVal = friendlyID } slug = sql.NullString{slugVal, true} } } created := time.Now() if db.driverName == driverSQLite { // SQLite stores datetimes in UTC, so convert time.Now() to it here created = created.UTC() } if post.Created != nil { created, err = time.Parse("2006-01-02T15:04:05Z", *post.Created) if err != nil { log.Error("Unable to parse Created time '%s': %v", *post.Created, err) created = time.Now() if db.driverName == driverSQLite { // SQLite stores datetimes in UTC, so convert time.Now() to it here created = created.UTC() } } } stmt, err := db.Prepare("INSERT INTO posts (id, slug, title, content, text_appearance, language, rtl, privacy, owner_id, collection_id, created, updated, view_count) VALUES (?, ?, ?, ?, ?, ?, ?, ?, ?, ?, ?, " + db.now() + ", ?)") if err != nil { return nil, err } defer stmt.Close() _, err = stmt.Exec(friendlyID, slug, post.Title, post.Content, appearance, post.Language, post.IsRTL, 0, ownerID, ownerCollID, created, 0) if err != nil { if db.isDuplicateKeyErr(err) { // Duplicate entry error; try a new slug // TODO: make this a little more robust slug = sql.NullString{id.GenSafeUniqueSlug(slug.String), true} _, err = stmt.Exec(friendlyID, slug, post.Title, post.Content, appearance, post.Language, post.IsRTL, 0, ownerID, ownerCollID, created, 0) if err != nil { return nil, handleFailedPostInsert(fmt.Errorf("Retried slug generation, still failed: %v", err)) } } else { return nil, handleFailedPostInsert(err) } } // TODO: return Created field in proper format return &Post{ ID: friendlyID, Slug: null.NewString(slug.String, slug.Valid), Font: appearance, Language: zero.NewString(post.Language.String, post.Language.Valid), RTL: zero.NewBool(post.IsRTL.Bool, post.IsRTL.Valid), OwnerID: null.NewInt(userID, true), CollectionID: null.NewInt(userID, true), Created: created.Truncate(time.Second).UTC(), Updated: time.Now().Truncate(time.Second).UTC(), Title: zero.NewString(*(post.Title), true), Content: *(post.Content), }, nil } // UpdateOwnedPost updates an existing post with only the given fields in the // supplied AuthenticatedPost. func (db *datastore) UpdateOwnedPost(post *AuthenticatedPost, userID int64) error { params := []interface{}{} var queryUpdates, sep, authCondition string if post.Slug != nil && *post.Slug != "" { queryUpdates += sep + "slug = ?" sep = ", " params = append(params, getSlug(*post.Slug, "")) } if post.Content != nil { queryUpdates += sep + "content = ?" sep = ", " params = append(params, post.Content) } if post.Title != nil { queryUpdates += sep + "title = ?" sep = ", " params = append(params, post.Title) } if post.Language.Valid { queryUpdates += sep + "language = ?" sep = ", " params = append(params, post.Language.String) } if post.IsRTL.Valid { queryUpdates += sep + "rtl = ?" sep = ", " params = append(params, post.IsRTL.Bool) } if post.Font != "" { queryUpdates += sep + "text_appearance = ?" sep = ", " params = append(params, post.Font) } if post.Created != nil { createTime, err := time.Parse(postMetaDateFormat, *post.Created) if err != nil { log.Error("Unable to parse Created date: %v", err) return fmt.Errorf("That's the incorrect format for Created date.") } queryUpdates += sep + "created = ?" sep = ", " params = append(params, createTime) } // WHERE parameters... // id = ? params = append(params, post.ID) // AND owner_id = ? authCondition = "(owner_id = ?)" params = append(params, userID) if queryUpdates == "" { return ErrPostNoUpdatableVals } queryUpdates += sep + "updated = " + db.now() res, err := db.Exec("UPDATE posts SET "+queryUpdates+" WHERE id = ? AND "+authCondition, params...) if err != nil { log.Error("Unable to update owned post: %v", err) return err } rowsAffected, _ := res.RowsAffected() if rowsAffected == 0 { // Show the correct error message if nothing was updated var dummy int err := db.QueryRow("SELECT 1 FROM posts WHERE id = ? AND "+authCondition, post.ID, params[len(params)-1]).Scan(&dummy) switch { case err == sql.ErrNoRows: return ErrUnauthorizedEditPost case err != nil: log.Error("Failed selecting from posts: %v", err) } return nil } return nil } func (db *datastore) GetCollectionBy(condition string, value interface{}) (*Collection, error) { c := &Collection{} // FIXME: change Collection to reflect database values. Add helper functions to get actual values var styleSheet, script, format zero.String row := db.QueryRow("SELECT id, alias, title, description, style_sheet, script, format, owner_id, privacy, view_count FROM collections WHERE "+condition, value) err := row.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &styleSheet, &script, &format, &c.OwnerID, &c.Visibility, &c.Views) switch { case err == sql.ErrNoRows: return nil, impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."} case err != nil: log.Error("Failed selecting from collections: %v", err) return nil, err } c.StyleSheet = styleSheet.String c.Script = script.String c.Format = format.String c.Public = c.IsPublic() c.db = db return c, nil } func (db *datastore) GetCollection(alias string) (*Collection, error) { return db.GetCollectionBy("alias = ?", alias) } func (db *datastore) GetCollectionForPad(alias string) (*Collection, error) { c := &Collection{Alias: alias} row := db.QueryRow("SELECT id, alias, title, description, privacy FROM collections WHERE alias = ?", alias) err := row.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility) switch { case err == sql.ErrNoRows: return c, impart.HTTPError{http.StatusNotFound, "Collection doesn't exist."} case err != nil: log.Error("Failed selecting from collections: %v", err) return c, ErrInternalGeneral } c.Public = c.IsPublic() return c, nil } func (db *datastore) GetCollectionByID(id int64) (*Collection, error) { return db.GetCollectionBy("id = ?", id) } func (db *datastore) GetCollectionFromDomain(host string) (*Collection, error) { return db.GetCollectionBy("host = ?", host) } func (db *datastore) UpdateCollection(c *SubmittedCollection, alias string) error { q := query.NewUpdate(). SetStringPtr(c.Title, "title"). SetStringPtr(c.Description, "description"). SetNullString(c.StyleSheet, "style_sheet"). SetNullString(c.Script, "script") if c.Format != nil { cf := &CollectionFormat{Format: c.Format.String} if cf.Valid() { q.SetNullString(c.Format, "format") } } var updatePass bool if c.Visibility != nil && (collVisibility(*c.Visibility)&CollProtected == 0 || c.Pass != "") { q.SetIntPtr(c.Visibility, "privacy") if c.Pass != "" { updatePass = true } } // WHERE values q.Where("alias = ? AND owner_id = ?", alias, c.OwnerID) if q.Updates == "" { return ErrPostNoUpdatableVals } // Find any current domain var collID int64 var rowsAffected int64 var changed bool var res sql.Result err := db.QueryRow("SELECT id FROM collections WHERE alias = ?", alias).Scan(&collID) if err != nil { log.Error("Failed selecting from collections: %v. Some things won't work.", err) } // Update MathJax value if c.MathJax { if db.driverName == driverSQLite { _, err = db.Exec("INSERT OR REPLACE INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?)", collID, "render_mathjax", "1") } else { _, err = db.Exec("INSERT INTO collectionattributes (collection_id, attribute, value) VALUES (?, ?, ?) "+db.upsert("collection_id", "attribute")+" value = ?", collID, "render_mathjax", "1", "1") } if err != nil { log.Error("Unable to insert render_mathjax value: %v", err) return err } } else { _, err = db.Exec("DELETE FROM collectionattributes WHERE collection_id = ? AND attribute = ?", collID, "render_mathjax") if err != nil { log.Error("Unable to delete render_mathjax value: %v", err) return err } } // Update rest of the collection data res, err = db.Exec("UPDATE collections SET "+q.Updates+" WHERE "+q.Conditions, q.Params...) if err != nil { log.Error("Unable to update collection: %v", err) return err } rowsAffected, _ = res.RowsAffected() if !changed || rowsAffected == 0 { // Show the correct error message if nothing was updated var dummy int err := db.QueryRow("SELECT 1 FROM collections WHERE alias = ? AND owner_id = ?", alias, c.OwnerID).Scan(&dummy) switch { case err == sql.ErrNoRows: return ErrUnauthorizedEditPost case err != nil: log.Error("Failed selecting from collections: %v", err) } if !updatePass { return nil } } if updatePass { hashedPass, err := auth.HashPass([]byte(c.Pass)) if err != nil { log.Error("Unable to create hash: %s", err) return impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."} } if db.driverName == driverSQLite { _, err = db.Exec("INSERT OR REPLACE INTO collectionpasswords (collection_id, password) VALUES ((SELECT id FROM collections WHERE alias = ?), ?)", alias, hashedPass) } else { _, err = db.Exec("INSERT INTO collectionpasswords (collection_id, password) VALUES ((SELECT id FROM collections WHERE alias = ?), ?) "+db.upsert("collection_id")+" password = ?", alias, hashedPass, hashedPass) } if err != nil { return err } } return nil } const postCols = "id, slug, text_appearance, language, rtl, privacy, owner_id, collection_id, pinned_position, created, updated, view_count, title, content" // getEditablePost returns a PublicPost with the given ID only if the given // edit token is valid for the post. func (db *datastore) GetEditablePost(id, editToken string) (*PublicPost, error) { // FIXME: code duplicated from getPost() // TODO: add slight logic difference to getPost / one func var ownerName sql.NullString p := &Post{} row := db.QueryRow("SELECT "+postCols+", (SELECT username FROM users WHERE users.id = posts.owner_id) AS username FROM posts WHERE id = ? LIMIT 1", id) err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content, &ownerName) switch { case err == sql.ErrNoRows: return nil, ErrPostNotFound case err != nil: log.Error("Failed selecting from collections: %v", err) return nil, err } if p.Content == "" && p.Title.String == "" { return nil, ErrPostUnpublished } res := p.processPost() if ownerName.Valid { res.Owner = &PublicUser{Username: ownerName.String} } return &res, nil } func (db *datastore) PostIDExists(id string) bool { var dummy bool err := db.QueryRow("SELECT 1 FROM posts WHERE id = ?", id).Scan(&dummy) return err == nil && dummy } // GetPost gets a public-facing post object from the database. If collectionID // is > 0, the post will be retrieved by slug and collection ID, rather than // post ID. // TODO: break this into two functions: // - GetPost(id string) // - GetCollectionPost(slug string, collectionID int64) func (db *datastore) GetPost(id string, collectionID int64) (*PublicPost, error) { var ownerName sql.NullString p := &Post{} var row *sql.Row var where string params := []interface{}{id} if collectionID > 0 { where = "slug = ? AND collection_id = ?" params = append(params, collectionID) } else { where = "id = ?" } row = db.QueryRow("SELECT "+postCols+", (SELECT username FROM users WHERE users.id = posts.owner_id) AS username FROM posts WHERE "+where+" LIMIT 1", params...) err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content, &ownerName) switch { case err == sql.ErrNoRows: if collectionID > 0 { return nil, ErrCollectionPageNotFound } return nil, ErrPostNotFound case err != nil: log.Error("Failed selecting from collections: %v", err) return nil, err } if p.Content == "" && p.Title.String == "" { return nil, ErrPostUnpublished } res := p.processPost() if ownerName.Valid { res.Owner = &PublicUser{Username: ownerName.String} } return &res, nil } // TODO: don't duplicate getPost() functionality func (db *datastore) GetOwnedPost(id string, ownerID int64) (*PublicPost, error) { p := &Post{} var row *sql.Row where := "id = ? AND owner_id = ?" params := []interface{}{id, ownerID} row = db.QueryRow("SELECT "+postCols+" FROM posts WHERE "+where+" LIMIT 1", params...) err := row.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content) switch { case err == sql.ErrNoRows: return nil, ErrPostNotFound case err != nil: log.Error("Failed selecting from collections: %v", err) return nil, err } if p.Content == "" && p.Title.String == "" { return nil, ErrPostUnpublished } res := p.processPost() return &res, nil } func (db *datastore) GetPostProperty(id string, collectionID int64, property string) (interface{}, error) { propSelects := map[string]string{ "views": "view_count AS views", } selectQuery, ok := propSelects[property] if !ok { return nil, impart.HTTPError{http.StatusBadRequest, fmt.Sprintf("Invalid property: %s.", property)} } var res interface{} var row *sql.Row if collectionID != 0 { row = db.QueryRow("SELECT "+selectQuery+" FROM posts WHERE slug = ? AND collection_id = ? LIMIT 1", id, collectionID) } else { row = db.QueryRow("SELECT "+selectQuery+" FROM posts WHERE id = ? LIMIT 1", id) } err := row.Scan(&res) switch { case err == sql.ErrNoRows: return nil, impart.HTTPError{http.StatusNotFound, "Post not found."} case err != nil: log.Error("Failed selecting post: %v", err) return nil, err } return res, nil } // GetPostsCount modifies the CollectionObj to include the correct number of // standard (non-pinned) posts. It will return future posts if `includeFuture` // is true. func (db *datastore) GetPostsCount(c *CollectionObj, includeFuture bool) { var count int64 timeCondition := "" if !includeFuture { timeCondition = "AND created <= " + db.now() } err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE collection_id = ? AND pinned_position IS NULL "+timeCondition, c.ID).Scan(&count) switch { case err == sql.ErrNoRows: c.TotalPosts = 0 case err != nil: log.Error("Failed selecting from collections: %v", err) c.TotalPosts = 0 } c.TotalPosts = int(count) } // GetPosts retrieves all posts for the given Collection. // It will return future posts if `includeFuture` is true. // It will include only standard (non-pinned) posts unless `includePinned` is true. // TODO: change includeFuture to isOwner, since that's how it's used func (db *datastore) GetPosts(cfg *config.Config, c *Collection, page int, includeFuture, forceRecentFirst, includePinned bool) (*[]PublicPost, error) { collID := c.ID cf := c.NewFormat() order := "DESC" if cf.Ascending() && !forceRecentFirst { order = "ASC" } pagePosts := cf.PostsPerPage() start := page*pagePosts - pagePosts if page == 0 { start = 0 pagePosts = 1000 } limitStr := "" if page > 0 { limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts) } timeCondition := "" if !includeFuture { timeCondition = "AND created <= " + db.now() } pinnedCondition := "" if !includePinned { pinnedCondition = "AND pinned_position IS NULL" } rows, err := db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? "+pinnedCondition+" "+timeCondition+" ORDER BY created "+order+limitStr, collID) if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts."} } defer rows.Close() // TODO: extract this common row scanning logic for queries using `postCols` posts := []PublicPost{} for rows.Next() { p := &Post{} err = rows.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content) if err != nil { log.Error("Failed scanning row: %v", err) break } p.extractData() p.formatContent(cfg, c, includeFuture) posts = append(posts, p.processPost()) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } return &posts, nil } // GetPostsTagged retrieves all posts on the given Collection that contain the // given tag. // It will return future posts if `includeFuture` is true. // TODO: change includeFuture to isOwner, since that's how it's used func (db *datastore) GetPostsTagged(cfg *config.Config, c *Collection, tag string, page int, includeFuture bool) (*[]PublicPost, error) { collID := c.ID cf := c.NewFormat() order := "DESC" if cf.Ascending() { order = "ASC" } pagePosts := cf.PostsPerPage() start := page*pagePosts - pagePosts if page == 0 { start = 0 pagePosts = 1000 } limitStr := "" if page > 0 { limitStr = fmt.Sprintf(" LIMIT %d, %d", start, pagePosts) } timeCondition := "" if !includeFuture { timeCondition = "AND created <= " + db.now() } var rows *sql.Rows var err error if db.driverName == driverSQLite { rows, err = db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? AND LOWER(content) regexp ? "+timeCondition+" ORDER BY created "+order+limitStr, collID, `.*#`+strings.ToLower(tag)+`\b.*`) } else { rows, err = db.Query("SELECT "+postCols+" FROM posts WHERE collection_id = ? AND LOWER(content) RLIKE ? "+timeCondition+" ORDER BY created "+order+limitStr, collID, "#"+strings.ToLower(tag)+"[[:>:]]") } if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve collection posts."} } defer rows.Close() // TODO: extract this common row scanning logic for queries using `postCols` posts := []PublicPost{} for rows.Next() { p := &Post{} err = rows.Scan(&p.ID, &p.Slug, &p.Font, &p.Language, &p.RTL, &p.Privacy, &p.OwnerID, &p.CollectionID, &p.PinnedPosition, &p.Created, &p.Updated, &p.ViewCount, &p.Title, &p.Content) if err != nil { log.Error("Failed scanning row: %v", err) break } p.extractData() p.formatContent(cfg, c, includeFuture) posts = append(posts, p.processPost()) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } return &posts, nil } func (db *datastore) GetAPFollowers(c *Collection) (*[]RemoteUser, error) { rows, err := db.Query("SELECT actor_id, inbox, shared_inbox FROM remotefollows f INNER JOIN remoteusers u ON f.remote_user_id = u.id WHERE collection_id = ?", c.ID) if err != nil { log.Error("Failed selecting from followers: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve followers."} } defer rows.Close() followers := []RemoteUser{} for rows.Next() { f := RemoteUser{} err = rows.Scan(&f.ActorID, &f.Inbox, &f.SharedInbox) followers = append(followers, f) } return &followers, nil } // CanCollect returns whether or not the given user can add the given post to a // collection. This is true when a post is already owned by the user. // NOTE: this is currently only used to potentially add owned posts to a // collection. This has the SIDE EFFECT of also generating a slug for the post. // FIXME: make this side effect more explicit (or extract it) func (db *datastore) CanCollect(cpr *ClaimPostRequest, userID int64) bool { var title, content string var lang sql.NullString err := db.QueryRow("SELECT title, content, language FROM posts WHERE id = ? AND owner_id = ?", cpr.ID, userID).Scan(&title, &content, &lang) switch { case err == sql.ErrNoRows: return false case err != nil: log.Error("Failed on post CanCollect(%s, %d): %v", cpr.ID, userID, err) return false } // Since we have the post content and the post is collectable, generate the // post's slug now. cpr.Slug = getSlugFromPost(title, content, lang.String) return true } func (db *datastore) AttemptClaim(p *ClaimPostRequest, query string, params []interface{}, slugIdx int) (sql.Result, error) { qRes, err := db.Exec(query, params...) if err != nil { if db.isDuplicateKeyErr(err) && slugIdx > -1 { s := id.GenSafeUniqueSlug(p.Slug) if s == p.Slug { // Sanity check to prevent infinite recursion return qRes, fmt.Errorf("GenSafeUniqueSlug generated nothing unique: %s", s) } p.Slug = s params[slugIdx] = p.Slug return db.AttemptClaim(p, query, params, slugIdx) } return qRes, fmt.Errorf("attemptClaim: %s", err) } return qRes, nil } func (db *datastore) DispersePosts(userID int64, postIDs []string) (*[]ClaimPostResult, error) { postClaimReqs := map[string]bool{} res := []ClaimPostResult{} for i := range postIDs { postID := postIDs[i] r := ClaimPostResult{Code: 0, ErrorMessage: ""} // Perform post validation if postID == "" { r.ErrorMessage = "Missing post ID. " } if _, ok := postClaimReqs[postID]; ok { r.Code = 429 r.ErrorMessage = "You've already tried anonymizing this post." r.ID = postID res = append(res, r) continue } postClaimReqs[postID] = true var err error // Get full post information to return var fullPost *PublicPost fullPost, err = db.GetPost(postID, 0) if err != nil { if err, ok := err.(impart.HTTPError); ok { r.Code = err.Status r.ErrorMessage = err.Message r.ID = postID res = append(res, r) continue } else { log.Error("Error getting post in dispersePosts: %v", err) } } if fullPost.OwnerID.Int64 != userID { r.Code = http.StatusConflict r.ErrorMessage = "Post is already owned by someone else." r.ID = postID res = append(res, r) continue } var qRes sql.Result var query string var params []interface{} // Do AND owner_id = ? for sanity. // This should've been caught and returned with a good error message // just above. query = "UPDATE posts SET collection_id = NULL WHERE id = ? AND owner_id = ?" params = []interface{}{postID, userID} qRes, err = db.Exec(query, params...) if err != nil { r.Code = http.StatusInternalServerError r.ErrorMessage = "A glitch happened on our end." r.ID = postID res = append(res, r) log.Error("dispersePosts (post %s): %v", postID, err) continue } // Post was successfully dispersed r.Code = http.StatusOK r.Post = fullPost rowsAffected, _ := qRes.RowsAffected() if rowsAffected == 0 { // This was already claimed, but return 200 r.Code = http.StatusOK } res = append(res, r) } return &res, nil } func (db *datastore) ClaimPosts(cfg *config.Config, userID int64, collAlias string, posts *[]ClaimPostRequest) (*[]ClaimPostResult, error) { postClaimReqs := map[string]bool{} res := []ClaimPostResult{} postCollAlias := collAlias for i := range *posts { p := (*posts)[i] if &p == nil { continue } r := ClaimPostResult{Code: 0, ErrorMessage: ""} // Perform post validation if p.ID == "" { r.ErrorMessage = "Missing post ID `id`. " } if _, ok := postClaimReqs[p.ID]; ok { r.Code = 429 r.ErrorMessage = "You've already tried claiming this post." r.ID = p.ID res = append(res, r) continue } postClaimReqs[p.ID] = true canCollect := db.CanCollect(&p, userID) if !canCollect && p.Token == "" { // TODO: ensure post isn't owned by anyone else when a valid modify // token is given. r.ErrorMessage += "Missing post Edit Token `token`." } if r.ErrorMessage != "" { // Post validate failed r.Code = http.StatusBadRequest r.ID = p.ID res = append(res, r) continue } var err error var qRes sql.Result var query string var params []interface{} var slugIdx int = -1 var coll *Collection if collAlias == "" { // Posts are being claimed at /posts/claim, not // /collections/{alias}/collect, so use given individual collection // to associate post with. postCollAlias = p.CollectionAlias } if postCollAlias != "" { // Associate this post with a collection if p.CreateCollection { // This is a new collection // TODO: consider removing this. This seriously complicates this // method and adds another (unnecessary?) logic path. coll, err = db.CreateCollection(cfg, postCollAlias, "", userID) if err != nil { if err, ok := err.(impart.HTTPError); ok { r.Code = err.Status r.ErrorMessage = err.Message } else { r.Code = http.StatusInternalServerError r.ErrorMessage = "Unknown error occurred creating collection" } r.ID = p.ID res = append(res, r) continue } } else { // Attempt to add to existing collection coll, err = db.GetCollection(postCollAlias) if err != nil { if err, ok := err.(impart.HTTPError); ok { if err.Status == http.StatusNotFound { // Show obfuscated "forbidden" response, as if attempting to add to an // unowned blog. r.Code = ErrForbiddenCollection.Status r.ErrorMessage = ErrForbiddenCollection.Message } else { r.Code = err.Status r.ErrorMessage = err.Message } } else { r.Code = http.StatusInternalServerError r.ErrorMessage = "Unknown error occurred claiming post with collection" } r.ID = p.ID res = append(res, r) continue } if coll.OwnerID != userID { r.Code = ErrForbiddenCollection.Status r.ErrorMessage = ErrForbiddenCollection.Message r.ID = p.ID res = append(res, r) continue } } if p.Slug == "" { p.Slug = p.ID } if canCollect { // User already owns this post, so just add it to the given // collection. query = "UPDATE posts SET collection_id = ?, slug = ? WHERE id = ? AND owner_id = ?" params = []interface{}{coll.ID, p.Slug, p.ID, userID} slugIdx = 1 } else { query = "UPDATE posts SET owner_id = ?, collection_id = ?, slug = ? WHERE id = ? AND modify_token = ? AND owner_id IS NULL" params = []interface{}{userID, coll.ID, p.Slug, p.ID, p.Token} slugIdx = 2 } } else { query = "UPDATE posts SET owner_id = ? WHERE id = ? AND modify_token = ? AND owner_id IS NULL" params = []interface{}{userID, p.ID, p.Token} } qRes, err = db.AttemptClaim(&p, query, params, slugIdx) if err != nil { r.Code = http.StatusInternalServerError r.ErrorMessage = "An unknown error occurred." r.ID = p.ID res = append(res, r) log.Error("claimPosts (post %s): %v", p.ID, err) continue } // Get full post information to return var fullPost *PublicPost if p.Token != "" { fullPost, err = db.GetEditablePost(p.ID, p.Token) } else { fullPost, err = db.GetPost(p.ID, 0) } if err != nil { if err, ok := err.(impart.HTTPError); ok { r.Code = err.Status r.ErrorMessage = err.Message r.ID = p.ID res = append(res, r) continue } } if fullPost.OwnerID.Int64 != userID { r.Code = http.StatusConflict r.ErrorMessage = "Post is already owned by someone else." r.ID = p.ID res = append(res, r) continue } // Post was successfully claimed r.Code = http.StatusOK r.Post = fullPost if coll != nil { r.Post.Collection = &CollectionObj{Collection: *coll} } rowsAffected, _ := qRes.RowsAffected() if rowsAffected == 0 { // This was already claimed, but return 200 r.Code = http.StatusOK } res = append(res, r) } return &res, nil } func (db *datastore) UpdatePostPinState(pinned bool, postID string, collID, ownerID, pos int64) error { if pos <= 0 || pos > 20 { pos = db.GetLastPinnedPostPos(collID) + 1 if pos == -1 { pos = 1 } } var err error if pinned { _, err = db.Exec("UPDATE posts SET pinned_position = ? WHERE id = ?", pos, postID) } else { _, err = db.Exec("UPDATE posts SET pinned_position = NULL WHERE id = ?", postID) } if err != nil { log.Error("Unable to update pinned post: %v", err) return err } return nil } func (db *datastore) GetLastPinnedPostPos(collID int64) int64 { var lastPos sql.NullInt64 err := db.QueryRow("SELECT MAX(pinned_position) FROM posts WHERE collection_id = ? AND pinned_position IS NOT NULL", collID).Scan(&lastPos) switch { case err == sql.ErrNoRows: return -1 case err != nil: log.Error("Failed selecting from posts: %v", err) return -1 } if !lastPos.Valid { return -1 } return lastPos.Int64 } func (db *datastore) GetPinnedPosts(coll *CollectionObj) (*[]PublicPost, error) { // FIXME: sqlite-backed instances don't include ellipsis on truncated titles rows, err := db.Query("SELECT id, slug, title, "+db.clip("content", 80)+", pinned_position FROM posts WHERE collection_id = ? AND pinned_position IS NOT NULL ORDER BY pinned_position ASC", coll.ID) if err != nil { log.Error("Failed selecting pinned posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve pinned posts."} } defer rows.Close() posts := []PublicPost{} for rows.Next() { p := &Post{} err = rows.Scan(&p.ID, &p.Slug, &p.Title, &p.Content, &p.PinnedPosition) if err != nil { log.Error("Failed scanning row: %v", err) break } p.extractData() pp := p.processPost() pp.Collection = coll posts = append(posts, pp) } return &posts, nil } -func (db *datastore) GetCollections(u *User) (*[]Collection, error) { +func (db *datastore) GetCollections(u *User, hostName string) (*[]Collection, error) { rows, err := db.Query("SELECT id, alias, title, description, privacy, view_count FROM collections WHERE owner_id = ? ORDER BY id ASC", u.ID) if err != nil { log.Error("Failed selecting from collections: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user collections."} } defer rows.Close() colls := []Collection{} for rows.Next() { c := Collection{} err = rows.Scan(&c.ID, &c.Alias, &c.Title, &c.Description, &c.Visibility, &c.Views) if err != nil { log.Error("Failed scanning row: %v", err) break } + c.hostName = hostName c.URL = c.CanonicalURL() c.Public = c.IsPublic() colls = append(colls, c) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } return &colls, nil } -func (db *datastore) GetPublishableCollections(u *User) (*[]Collection, error) { - c, err := db.GetCollections(u) +func (db *datastore) GetPublishableCollections(u *User, hostName string) (*[]Collection, error) { + c, err := db.GetCollections(u, hostName) if err != nil { return nil, err } if len(*c) == 0 { return nil, impart.HTTPError{http.StatusInternalServerError, "You don't seem to have any blogs; they might've moved to another account. Try logging out and logging into your other account."} } return c, nil } func (db *datastore) GetMeStats(u *User) userMeStats { s := userMeStats{} // User counts colls, _ := db.GetUserCollectionCount(u.ID) s.TotalCollections = colls var articles, collPosts uint64 err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ? AND collection_id IS NULL", u.ID).Scan(&articles) if err != nil && err != sql.ErrNoRows { log.Error("Couldn't get articles count for user %d: %v", u.ID, err) } s.TotalArticles = articles err = db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ? AND collection_id IS NOT NULL", u.ID).Scan(&collPosts) if err != nil && err != sql.ErrNoRows { log.Error("Couldn't get coll posts count for user %d: %v", u.ID, err) } s.CollectionPosts = collPosts return s } func (db *datastore) GetTotalCollections() (collCount int64, err error) { err = db.QueryRow(`SELECT COUNT(*) FROM collections`).Scan(&collCount) if err != nil { log.Error("Unable to fetch collections count: %v", err) } return } func (db *datastore) GetTotalPosts() (postCount int64, err error) { err = db.QueryRow(`SELECT COUNT(*) FROM posts`).Scan(&postCount) if err != nil { log.Error("Unable to fetch posts count: %v", err) } return } func (db *datastore) GetTopPosts(u *User, alias string) (*[]PublicPost, error) { params := []interface{}{u.ID} where := "" if alias != "" { where = " AND alias = ?" params = append(params, alias) } rows, err := db.Query("SELECT p.id, p.slug, p.view_count, p.title, c.alias, c.title, c.description, c.view_count FROM posts p LEFT JOIN collections c ON p.collection_id = c.id WHERE p.owner_id = ?"+where+" ORDER BY p.view_count DESC, created DESC LIMIT 25", params...) if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user top posts."} } defer rows.Close() posts := []PublicPost{} var gotErr bool for rows.Next() { p := Post{} c := Collection{} var alias, title, description sql.NullString var views sql.NullInt64 err = rows.Scan(&p.ID, &p.Slug, &p.ViewCount, &p.Title, &alias, &title, &description, &views) if err != nil { log.Error("Failed scanning User.getPosts() row: %v", err) gotErr = true break } p.extractData() pubPost := p.processPost() if alias.Valid && alias.String != "" { c.Alias = alias.String c.Title = title.String c.Description = description.String c.Views = views.Int64 pubPost.Collection = &CollectionObj{Collection: c} } posts = append(posts, pubPost) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } if gotErr && len(posts) == 0 { // There were a lot of errors return nil, impart.HTTPError{http.StatusInternalServerError, "Unable to get data."} } return &posts, nil } func (db *datastore) GetAnonymousPosts(u *User) (*[]PublicPost, error) { rows, err := db.Query("SELECT id, view_count, title, created, updated, content FROM posts WHERE owner_id = ? AND collection_id IS NULL ORDER BY created DESC", u.ID) if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user anonymous posts."} } defer rows.Close() posts := []PublicPost{} for rows.Next() { p := Post{} err = rows.Scan(&p.ID, &p.ViewCount, &p.Title, &p.Created, &p.Updated, &p.Content) if err != nil { log.Error("Failed scanning row: %v", err) break } p.extractData() posts = append(posts, p.processPost()) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } return &posts, nil } func (db *datastore) GetUserPosts(u *User) (*[]PublicPost, error) { rows, err := db.Query("SELECT p.id, p.slug, p.view_count, p.title, p.created, p.updated, p.content, p.text_appearance, p.language, p.rtl, c.alias, c.title, c.description, c.view_count FROM posts p LEFT JOIN collections c ON collection_id = c.id WHERE p.owner_id = ? ORDER BY created ASC", u.ID) if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user posts."} } defer rows.Close() posts := []PublicPost{} var gotErr bool for rows.Next() { p := Post{} c := Collection{} var alias, title, description sql.NullString var views sql.NullInt64 err = rows.Scan(&p.ID, &p.Slug, &p.ViewCount, &p.Title, &p.Created, &p.Updated, &p.Content, &p.Font, &p.Language, &p.RTL, &alias, &title, &description, &views) if err != nil { log.Error("Failed scanning User.getPosts() row: %v", err) gotErr = true break } p.extractData() pubPost := p.processPost() if alias.Valid && alias.String != "" { c.Alias = alias.String c.Title = title.String c.Description = description.String c.Views = views.Int64 pubPost.Collection = &CollectionObj{Collection: c} } posts = append(posts, pubPost) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } if gotErr && len(posts) == 0 { // There were a lot of errors return nil, impart.HTTPError{http.StatusInternalServerError, "Unable to get data."} } return &posts, nil } func (db *datastore) GetUserPostsCount(userID int64) int64 { var count int64 err := db.QueryRow("SELECT COUNT(*) FROM posts WHERE owner_id = ?", userID).Scan(&count) switch { case err == sql.ErrNoRows: return 0 case err != nil: log.Error("Failed selecting posts count for user %d: %v", userID, err) return 0 } return count } // ChangeSettings takes a User and applies the changes in the given // userSettings, MODIFYING THE USER with successful changes. func (db *datastore) ChangeSettings(app *App, u *User, s *userSettings) error { var errPass error q := query.NewUpdate() // Update email if given if s.Email != "" { encEmail, err := data.Encrypt(app.keys.EmailKey, s.Email) if err != nil { log.Error("Couldn't encrypt email %s: %s\n", s.Email, err) return impart.HTTPError{http.StatusInternalServerError, "Unable to encrypt email address."} } q.SetBytes(encEmail, "email") // Update the email if something goes awry updating the password defer func() { if errPass != nil { db.UpdateEncryptedUserEmail(u.ID, encEmail) } }() u.Email = zero.StringFrom(s.Email) } // Update username if given var newUsername string if s.Username != "" { var ie *impart.HTTPError newUsername, ie = getValidUsername(app, s.Username, u.Username) if ie != nil { // Username is invalid return *ie } if !author.IsValidUsername(app.cfg, newUsername) { // Ensure the username is syntactically correct. return impart.HTTPError{http.StatusPreconditionFailed, "Username isn't valid."} } t, err := db.Begin() if err != nil { log.Error("Couldn't start username change transaction: %v", err) return err } _, err = t.Exec("UPDATE users SET username = ? WHERE id = ?", newUsername, u.ID) if err != nil { t.Rollback() if db.isDuplicateKeyErr(err) { return impart.HTTPError{http.StatusConflict, "Username is already taken."} } log.Error("Unable to update users table: %v", err) return ErrInternalGeneral } _, err = t.Exec("UPDATE collections SET alias = ? WHERE alias = ? AND owner_id = ?", newUsername, u.Username, u.ID) if err != nil { t.Rollback() if db.isDuplicateKeyErr(err) { return impart.HTTPError{http.StatusConflict, "Username is already taken."} } log.Error("Unable to update collection: %v", err) return ErrInternalGeneral } // Keep track of name changes for redirection db.RemoveCollectionRedirect(t, newUsername) _, err = t.Exec("UPDATE collectionredirects SET new_alias = ? WHERE new_alias = ?", newUsername, u.Username) if err != nil { log.Error("Unable to update collectionredirects: %v", err) } _, err = t.Exec("INSERT INTO collectionredirects (prev_alias, new_alias) VALUES (?, ?)", u.Username, newUsername) if err != nil { log.Error("Unable to add new collectionredirect: %v", err) } err = t.Commit() if err != nil { t.Rollback() log.Error("Rolling back after Commit(): %v\n", err) return err } u.Username = newUsername } // Update passphrase if given if s.NewPass != "" { // Check if user has already set a password var err error u.HasPass, err = db.IsUserPassSet(u.ID) if err != nil { errPass = impart.HTTPError{http.StatusInternalServerError, "Unable to retrieve user data."} return errPass } if u.HasPass { // Check if currently-set password is correct hashedPass := u.HashedPass if len(hashedPass) == 0 { authUser, err := db.GetUserForAuthByID(u.ID) if err != nil { errPass = err return errPass } hashedPass = authUser.HashedPass } if !auth.Authenticated(hashedPass, []byte(s.OldPass)) { errPass = impart.HTTPError{http.StatusUnauthorized, "Incorrect password."} return errPass } } hashedPass, err := auth.HashPass([]byte(s.NewPass)) if err != nil { errPass = impart.HTTPError{http.StatusInternalServerError, "Could not create password hash."} return errPass } q.SetBytes(hashedPass, "password") } // WHERE values q.Append(u.ID) if q.Updates == "" { if s.Username == "" { return ErrPostNoUpdatableVals } // Nothing to update except username. That was successful, so return now. return nil } res, err := db.Exec("UPDATE users SET "+q.Updates+" WHERE id = ?", q.Params...) if err != nil { log.Error("Unable to update collection: %v", err) return err } rowsAffected, _ := res.RowsAffected() if rowsAffected == 0 { // Show the correct error message if nothing was updated var dummy int err := db.QueryRow("SELECT 1 FROM users WHERE id = ?", u.ID).Scan(&dummy) switch { case err == sql.ErrNoRows: return ErrUnauthorizedGeneral case err != nil: log.Error("Failed selecting from users: %v", err) } return nil } if s.NewPass != "" && !u.HasPass { u.HasPass = true } return nil } func (db *datastore) ChangePassphrase(userID int64, sudo bool, curPass string, hashedPass []byte) error { var dbPass []byte err := db.QueryRow("SELECT password FROM users WHERE id = ?", userID).Scan(&dbPass) switch { case err == sql.ErrNoRows: return ErrUserNotFound case err != nil: log.Error("Couldn't SELECT user password for change: %v", err) return err } if !sudo && !auth.Authenticated(dbPass, []byte(curPass)) { return impart.HTTPError{http.StatusUnauthorized, "Incorrect password."} } _, err = db.Exec("UPDATE users SET password = ? WHERE id = ?", hashedPass, userID) if err != nil { log.Error("Could not update passphrase: %v", err) return err } return nil } func (db *datastore) RemoveCollectionRedirect(t *sql.Tx, alias string) error { _, err := t.Exec("DELETE FROM collectionredirects WHERE prev_alias = ?", alias) if err != nil { log.Error("Unable to delete from collectionredirects: %v", err) return err } return nil } func (db *datastore) GetCollectionRedirect(alias string) (new string) { row := db.QueryRow("SELECT new_alias FROM collectionredirects WHERE prev_alias = ?", alias) err := row.Scan(&new) if err != nil && err != sql.ErrNoRows { log.Error("Failed selecting from collectionredirects: %v", err) } return } func (db *datastore) DeleteCollection(alias string, userID int64) error { c := &Collection{Alias: alias} var username string row := db.QueryRow("SELECT username FROM users WHERE id = ?", userID) err := row.Scan(&username) if err != nil { return err } // Ensure user isn't deleting their main blog if alias == username { return impart.HTTPError{http.StatusForbidden, "You cannot currently delete your primary blog."} } row = db.QueryRow("SELECT id FROM collections WHERE alias = ? AND owner_id = ?", alias, userID) err = row.Scan(&c.ID) switch { case err == sql.ErrNoRows: return impart.HTTPError{http.StatusNotFound, "Collection doesn't exist or you're not allowed to delete it."} case err != nil: log.Error("Failed selecting from collections: %v", err) return ErrInternalGeneral } t, err := db.Begin() if err != nil { return err } // Float all collection's posts _, err = t.Exec("UPDATE posts SET collection_id = NULL WHERE collection_id = ? AND owner_id = ?", c.ID, userID) if err != nil { t.Rollback() return err } // Remove redirects to or from this collection _, err = t.Exec("DELETE FROM collectionredirects WHERE prev_alias = ? OR new_alias = ?", alias, alias) if err != nil { t.Rollback() return err } // Remove any optional collection password _, err = t.Exec("DELETE FROM collectionpasswords WHERE collection_id = ?", c.ID) if err != nil { t.Rollback() return err } // Finally, delete collection itself _, err = t.Exec("DELETE FROM collections WHERE id = ?", c.ID) if err != nil { t.Rollback() return err } err = t.Commit() if err != nil { t.Rollback() return err } return nil } func (db *datastore) IsCollectionAttributeOn(id int64, attr string) bool { var v string err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&v) switch { case err == sql.ErrNoRows: return false case err != nil: log.Error("Couldn't SELECT value in isCollectionAttributeOn for attribute '%s': %v", attr, err) return false } return v == "1" } func (db *datastore) CollectionHasAttribute(id int64, attr string) bool { var dummy string err := db.QueryRow("SELECT value FROM collectionattributes WHERE collection_id = ? AND attribute = ?", id, attr).Scan(&dummy) switch { case err == sql.ErrNoRows: return false case err != nil: log.Error("Couldn't SELECT value in collectionHasAttribute for attribute '%s': %v", attr, err) return false } return true } func (db *datastore) DeleteAccount(userID int64) (l *string, err error) { debug := "" l = &debug t, err := db.Begin() if err != nil { stringLogln(l, "Unable to begin: %v", err) return } // Get all collections rows, err := db.Query("SELECT id, alias FROM collections WHERE owner_id = ?", userID) if err != nil { t.Rollback() stringLogln(l, "Unable to get collections: %v", err) return } defer rows.Close() colls := []Collection{} var c Collection for rows.Next() { err = rows.Scan(&c.ID, &c.Alias) if err != nil { t.Rollback() stringLogln(l, "Unable to scan collection cols: %v", err) return } colls = append(colls, c) } var res sql.Result for _, c := range colls { // TODO: user deleteCollection() func // Delete tokens res, err = t.Exec("DELETE FROM collectionattributes WHERE collection_id = ?", c.ID) if err != nil { t.Rollback() stringLogln(l, "Unable to delete attributes on %s: %v", c.Alias, err) return } rs, _ := res.RowsAffected() stringLogln(l, "Deleted %d for %s from collectionattributes", rs, c.Alias) // Remove any optional collection password res, err = t.Exec("DELETE FROM collectionpasswords WHERE collection_id = ?", c.ID) if err != nil { t.Rollback() stringLogln(l, "Unable to delete passwords on %s: %v", c.Alias, err) return } rs, _ = res.RowsAffected() stringLogln(l, "Deleted %d for %s from collectionpasswords", rs, c.Alias) // Remove redirects to this collection res, err = t.Exec("DELETE FROM collectionredirects WHERE new_alias = ?", c.Alias) if err != nil { t.Rollback() stringLogln(l, "Unable to delete redirects on %s: %v", c.Alias, err) return } rs, _ = res.RowsAffected() stringLogln(l, "Deleted %d for %s from collectionredirects", rs, c.Alias) } // Delete collections res, err = t.Exec("DELETE FROM collections WHERE owner_id = ?", userID) if err != nil { t.Rollback() stringLogln(l, "Unable to delete collections: %v", err) return } rs, _ := res.RowsAffected() stringLogln(l, "Deleted %d from collections", rs) // Delete tokens res, err = t.Exec("DELETE FROM accesstokens WHERE user_id = ?", userID) if err != nil { t.Rollback() stringLogln(l, "Unable to delete access tokens: %v", err) return } rs, _ = res.RowsAffected() stringLogln(l, "Deleted %d from accesstokens", rs) // Delete posts res, err = t.Exec("DELETE FROM posts WHERE owner_id = ?", userID) if err != nil { t.Rollback() stringLogln(l, "Unable to delete posts: %v", err) return } rs, _ = res.RowsAffected() stringLogln(l, "Deleted %d from posts", rs) res, err = t.Exec("DELETE FROM userattributes WHERE user_id = ?", userID) if err != nil { t.Rollback() stringLogln(l, "Unable to delete attributes: %v", err) return } rs, _ = res.RowsAffected() stringLogln(l, "Deleted %d from userattributes", rs) res, err = t.Exec("DELETE FROM users WHERE id = ?", userID) if err != nil { t.Rollback() stringLogln(l, "Unable to delete user: %v", err) return } rs, _ = res.RowsAffected() stringLogln(l, "Deleted %d from users", rs) err = t.Commit() if err != nil { t.Rollback() stringLogln(l, "Unable to commit: %v", err) return } return } func (db *datastore) GetAPActorKeys(collectionID int64) ([]byte, []byte) { var pub, priv []byte err := db.QueryRow("SELECT public_key, private_key FROM collectionkeys WHERE collection_id = ?", collectionID).Scan(&pub, &priv) switch { case err == sql.ErrNoRows: // Generate keys pub, priv = activitypub.GenerateKeys() _, err = db.Exec("INSERT INTO collectionkeys (collection_id, public_key, private_key) VALUES (?, ?, ?)", collectionID, pub, priv) if err != nil { log.Error("Unable to INSERT new activitypub keypair: %v", err) return nil, nil } case err != nil: log.Error("Couldn't SELECT collectionkeys: %v", err) return nil, nil } return pub, priv } func (db *datastore) CreateUserInvite(id string, userID int64, maxUses int, expires *time.Time) error { _, err := db.Exec("INSERT INTO userinvites (id, owner_id, max_uses, created, expires, inactive) VALUES (?, ?, ?, "+db.now()+", ?, 0)", id, userID, maxUses, expires) return err } func (db *datastore) GetUserInvites(userID int64) (*[]Invite, error) { rows, err := db.Query("SELECT id, max_uses, created, expires, inactive FROM userinvites WHERE owner_id = ? ORDER BY created DESC", userID) if err != nil { log.Error("Failed selecting from userinvites: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user invites."} } defer rows.Close() is := []Invite{} for rows.Next() { i := Invite{} err = rows.Scan(&i.ID, &i.MaxUses, &i.Created, &i.Expires, &i.Inactive) is = append(is, i) } return &is, nil } func (db *datastore) GetUserInvite(id string) (*Invite, error) { var i Invite err := db.QueryRow("SELECT id, max_uses, created, expires, inactive FROM userinvites WHERE id = ?", id).Scan(&i.ID, &i.MaxUses, &i.Created, &i.Expires, &i.Inactive) switch { case err == sql.ErrNoRows: return nil, impart.HTTPError{http.StatusNotFound, "Invite doesn't exist."} case err != nil: log.Error("Failed selecting invite: %v", err) return nil, err } return &i, nil } func (db *datastore) GetUsersInvitedCount(id string) int64 { var count int64 err := db.QueryRow("SELECT COUNT(*) FROM usersinvited WHERE invite_id = ?", id).Scan(&count) switch { case err == sql.ErrNoRows: return 0 case err != nil: log.Error("Failed selecting users invited count: %v", err) return 0 } return count } func (db *datastore) CreateInvitedUser(inviteID string, userID int64) error { _, err := db.Exec("INSERT INTO usersinvited (invite_id, user_id) VALUES (?, ?)", inviteID, userID) return err } func (db *datastore) GetInstancePages() ([]*instanceContent, error) { return db.GetAllDynamicContent("page") } func (db *datastore) GetAllDynamicContent(t string) ([]*instanceContent, error) { where := "" params := []interface{}{} if t != "" { where = " WHERE content_type = ?" params = append(params, t) } rows, err := db.Query("SELECT id, title, content, updated, content_type FROM appcontent"+where, params...) if err != nil { log.Error("Failed selecting from appcontent: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve instance pages."} } defer rows.Close() pages := []*instanceContent{} for rows.Next() { c := &instanceContent{} err = rows.Scan(&c.ID, &c.Title, &c.Content, &c.Updated, &c.Type) if err != nil { log.Error("Failed scanning row: %v", err) break } pages = append(pages, c) } err = rows.Err() if err != nil { log.Error("Error after Next() on rows: %v", err) } return pages, nil } func (db *datastore) GetDynamicContent(id string) (*instanceContent, error) { c := &instanceContent{ ID: id, } err := db.QueryRow("SELECT title, content, updated, content_type FROM appcontent WHERE id = ?", id).Scan(&c.Title, &c.Content, &c.Updated, &c.Type) switch { case err == sql.ErrNoRows: return nil, nil case err != nil: log.Error("Couldn't SELECT FROM appcontent for id '%s': %v", id, err) return nil, err } return c, nil } func (db *datastore) UpdateDynamicContent(id, title, content, contentType string) error { var err error if db.driverName == driverSQLite { _, err = db.Exec("INSERT OR REPLACE INTO appcontent (id, title, content, updated, content_type) VALUES (?, ?, ?, "+db.now()+", ?)", id, title, content, contentType) } else { _, err = db.Exec("INSERT INTO appcontent (id, title, content, updated, content_type) VALUES (?, ?, ?, "+db.now()+", ?) "+db.upsert("id")+" title = ?, content = ?, updated = "+db.now(), id, title, content, contentType, title, content) } if err != nil { log.Error("Unable to INSERT appcontent for '%s': %v", id, err) } return err } func (db *datastore) GetAllUsers(page uint) (*[]User, error) { limitStr := fmt.Sprintf("0, %d", adminUsersPerPage) if page > 1 { limitStr = fmt.Sprintf("%d, %d", (page-1)*adminUsersPerPage, adminUsersPerPage) } rows, err := db.Query("SELECT id, username, created FROM users ORDER BY created DESC LIMIT " + limitStr) if err != nil { log.Error("Failed selecting from posts: %v", err) return nil, impart.HTTPError{http.StatusInternalServerError, "Couldn't retrieve user posts."} } defer rows.Close() users := []User{} for rows.Next() { u := User{} err = rows.Scan(&u.ID, &u.Username, &u.Created) if err != nil { log.Error("Failed scanning GetAllUsers() row: %v", err) break } users = append(users, u) } return &users, nil } func (db *datastore) GetAllUsersCount() int64 { var count int64 err := db.QueryRow("SELECT COUNT(*) FROM users").Scan(&count) switch { case err == sql.ErrNoRows: return 0 case err != nil: log.Error("Failed selecting all users count: %v", err) return 0 } return count } func (db *datastore) GetUserLastPostTime(id int64) (*time.Time, error) { var t time.Time err := db.QueryRow("SELECT created FROM posts WHERE owner_id = ? ORDER BY created DESC LIMIT 1", id).Scan(&t) switch { case err == sql.ErrNoRows: return nil, nil case err != nil: log.Error("Failed selecting last post time from posts: %v", err) return nil, err } return &t, nil } func (db *datastore) GetCollectionLastPostTime(id int64) (*time.Time, error) { var t time.Time err := db.QueryRow("SELECT created FROM posts WHERE collection_id = ? ORDER BY created DESC LIMIT 1", id).Scan(&t) switch { case err == sql.ErrNoRows: return nil, nil case err != nil: log.Error("Failed selecting last post time from posts: %v", err) return nil, err } return &t, nil } // DatabaseInitialized returns whether or not the current datastore has been // initialized with the correct schema. // Currently, it checks to see if the `users` table exists. func (db *datastore) DatabaseInitialized() bool { var dummy string var err error if db.driverName == driverSQLite { err = db.QueryRow("SELECT name FROM sqlite_master WHERE type = 'table' AND name = 'users'").Scan(&dummy) } else { err = db.QueryRow("SHOW TABLES LIKE 'users'").Scan(&dummy) } switch { case err == sql.ErrNoRows: return false case err != nil: log.Error("Couldn't SHOW TABLES: %v", err) return false } return true } func stringLogln(log *string, s string, v ...interface{}) { *log += fmt.Sprintf(s+"\n", v...) } func handleFailedPostInsert(err error) error { log.Error("Couldn't insert into posts: %v", err) return err } diff --git a/export.go b/export.go index b30b59d..3b5ac49 100644 --- a/export.go +++ b/export.go @@ -1,131 +1,131 @@ /* * Copyright © 2018-2019 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "archive/zip" "bytes" "encoding/csv" "strings" "time" "github.com/writeas/web-core/log" ) func exportPostsCSV(u *User, posts *[]PublicPost) []byte { var b bytes.Buffer r := [][]string{ {"id", "slug", "blog", "url", "created", "title", "body"}, } for _, p := range *posts { var blog string if p.Collection != nil { blog = p.Collection.Alias } f := []string{p.ID, p.Slug.String, blog, p.CanonicalURL(), p.Created8601(), p.Title.String, strings.Replace(p.Content, "\n", "\\n", -1)} r = append(r, f) } w := csv.NewWriter(&b) w.WriteAll(r) // calls Flush internally if err := w.Error(); err != nil { log.Info("error writing csv: %v", err) } return b.Bytes() } type exportedTxt struct { Name, Title, Body string Mod time.Time } func exportPostsZip(u *User, posts *[]PublicPost) []byte { // Create a buffer to write our archive to. b := new(bytes.Buffer) // Create a new zip archive. w := zip.NewWriter(b) // Add some files to the archive. var filename string files := []exportedTxt{} for _, p := range *posts { filename = "" if p.Collection != nil { filename += p.Collection.Alias + "/" } if p.Slug.String != "" { filename += p.Slug.String + "_" } filename += p.ID + ".txt" files = append(files, exportedTxt{filename, p.Title.String, p.Content, p.Created}) } for _, file := range files { head := &zip.FileHeader{Name: file.Name} head.SetModTime(file.Mod) f, err := w.CreateHeader(head) if err != nil { log.Error("export zip header: %v", err) } var fullPost string if file.Title != "" { fullPost = "# " + file.Title + "\n\n" } fullPost += file.Body _, err = f.Write([]byte(fullPost)) if err != nil { log.Error("export zip write: %v", err) } } // Make sure to check the error on Close. err := w.Close() if err != nil { log.Error("export zip close: %v", err) } return b.Bytes() } func compileFullExport(app *App, u *User) *ExportUser { exportUser := &ExportUser{ User: u, } - colls, err := app.db.GetCollections(u) + colls, err := app.db.GetCollections(u, app.cfg.App.Host) if err != nil { log.Error("unable to fetch collections: %v", err) } posts, err := app.db.GetAnonymousPosts(u) if err != nil { log.Error("unable to fetch anon posts: %v", err) } exportUser.AnonymousPosts = *posts var collObjs []CollectionObj for _, c := range *colls { co := &CollectionObj{Collection: c} co.Posts, err = app.db.GetPosts(app.cfg, &c, 0, true, false, true) if err != nil { log.Error("unable to get collection posts: %v", err) } app.db.GetPostsCount(co, true) collObjs = append(collObjs, *co) } exportUser.Collections = &collObjs return exportUser } diff --git a/pad.go b/pad.go index 1545b4f..3cb7f37 100644 --- a/pad.go +++ b/pad.go @@ -1,175 +1,173 @@ /* * Copyright © 2018-2019 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( + "net/http" + "strings" + "github.com/gorilla/mux" "github.com/writeas/impart" "github.com/writeas/web-core/log" "github.com/writeas/writefreely/page" - "net/http" - "strings" ) func handleViewPad(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) action := vars["action"] slug := vars["slug"] collAlias := vars["collection"] if app.cfg.App.SingleUser { // TODO: refactor all of this, especially for single-user blogs c, err := app.db.GetCollectionByID(1) if err != nil { return err } collAlias = c.Alias } appData := &struct { page.StaticPage Post *RawPost User *User Blogs *[]Collection Editing bool // True if we're modifying an existing post EditCollection *Collection // Collection of the post we're editing, if any }{ StaticPage: pageForReq(app, r), Post: &RawPost{Font: "norm"}, User: getUserSession(app, r), } var err error if appData.User != nil { - appData.Blogs, err = app.db.GetPublishableCollections(appData.User) + appData.Blogs, err = app.db.GetPublishableCollections(appData.User, app.cfg.App.Host) if err != nil { log.Error("Unable to get user's blogs for Pad: %v", err) } } padTmpl := app.cfg.App.Editor - if padTmpl == "" { + if templates[padTmpl] == nil { + log.Info("No template '%s' found. Falling back to default 'pad' template.", padTmpl) padTmpl = "pad" } if action == "" && slug == "" { // Not editing any post; simply render the Pad - if templates[padTmpl] == nil { - log.Info("No template '%s' found. Falling back to default 'pad' template.", padTmpl) - padTmpl = "pad" - } if err = templates[padTmpl].ExecuteTemplate(w, "pad", appData); err != nil { log.Error("Unable to execute template: %v", err) } return nil } // Retrieve post information for editing appData.Editing = true // Make sure this isn't cached, so user doesn't accidentally lose data w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate") w.Header().Set("Expires", "Thu, 04 Oct 1990 20:00:00 GMT") if slug != "" { // TODO: refactor all of this, especially for single-user blogs appData.Post = getRawCollectionPost(app, slug, collAlias) if appData.Post.OwnerID != appData.User.ID { // TODO: add ErrForbiddenEditPost message to flashes return impart.HTTPError{http.StatusFound, r.URL.Path[:strings.LastIndex(r.URL.Path, "/edit")]} } appData.EditCollection, err = app.db.GetCollectionForPad(collAlias) if err != nil { return err } } else { // Editing a floating article appData.Post = getRawPost(app, action) appData.Post.Id = action } if appData.Post.Gone { return ErrPostUnpublished } else if appData.Post.Found && appData.Post.Content != "" { // Got the post } else if appData.Post.Found { return ErrPostFetchError } else { return ErrPostNotFound } if err = templates[padTmpl].ExecuteTemplate(w, "pad", appData); err != nil { log.Error("Unable to execute template: %v", err) } return nil } func handleViewMeta(app *App, w http.ResponseWriter, r *http.Request) error { vars := mux.Vars(r) action := vars["action"] slug := vars["slug"] collAlias := vars["collection"] appData := &struct { page.StaticPage Post *RawPost User *User EditCollection *Collection // Collection of the post we're editing, if any Flashes []string NeedsToken bool }{ StaticPage: pageForReq(app, r), Post: &RawPost{Font: "norm"}, User: getUserSession(app, r), } var err error if action == "" && slug == "" { return ErrPostNotFound } // Make sure this isn't cached, so user doesn't accidentally lose data w.Header().Set("Cache-Control", "no-cache, no-store, must-revalidate") w.Header().Set("Expires", "Thu, 28 Jul 1989 12:00:00 GMT") if slug != "" { appData.Post = getRawCollectionPost(app, slug, collAlias) if appData.Post.OwnerID != appData.User.ID { // TODO: add ErrForbiddenEditPost message to flashes return impart.HTTPError{http.StatusFound, r.URL.Path[:strings.LastIndex(r.URL.Path, "/meta")]} } if app.cfg.App.SingleUser { // TODO: optimize this query just like we do in GetCollectionForPad (?) appData.EditCollection, err = app.db.GetCollectionByID(1) } else { appData.EditCollection, err = app.db.GetCollectionForPad(collAlias) } if err != nil { return err } } else { // Editing a floating article appData.Post = getRawPost(app, action) appData.Post.Id = action } appData.NeedsToken = appData.User == nil || appData.User.ID != appData.Post.OwnerID if appData.Post.Gone { return ErrPostUnpublished } else if appData.Post.Found && appData.Post.Content != "" { // Got the post } else if appData.Post.Found { return ErrPostFetchError } else { return ErrPostNotFound } appData.Flashes, _ = getSessionFlashes(app, w, r, nil) if err = templates["edit-meta"].ExecuteTemplate(w, "edit-meta", appData); err != nil { log.Error("Unable to execute template: %v", err) } return nil } diff --git a/postrender.go b/postrender.go index 193b979..9ea6a7e 100644 --- a/postrender.go +++ b/postrender.go @@ -1,233 +1,235 @@ /* * Copyright © 2018 A Bunch Tell LLC. * * This file is part of WriteFreely. * * WriteFreely is free software: you can redistribute it and/or modify * it under the terms of the GNU Affero General Public License, included * in the LICENSE file in this source code package. */ package writefreely import ( "fmt" - "github.com/microcosm-cc/bluemonday" - stripmd "github.com/writeas/go-strip-markdown" - "github.com/writeas/saturday" - "github.com/writeas/web-core/stringmanip" - "github.com/writeas/writefreely/config" - "github.com/writeas/writefreely/parse" "html" "html/template" "regexp" "strings" "unicode" "unicode/utf8" + + "github.com/microcosm-cc/bluemonday" + stripmd "github.com/writeas/go-strip-markdown" + blackfriday "github.com/writeas/saturday" + "github.com/writeas/web-core/stringmanip" + "github.com/writeas/writefreely/config" + "github.com/writeas/writefreely/parse" ) var ( blockReg = regexp.MustCompile("<(ul|ol|blockquote)>\n") endBlockReg = regexp.MustCompile("\n") youtubeReg = regexp.MustCompile("(https?://www.youtube.com/embed/[a-zA-Z0-9\\-_]+)(\\?[^\t\n\f\r \"']+)?") titleElementReg = regexp.MustCompile("") hashtagReg = regexp.MustCompile(`{{\[\[\|\|([^|]+)\|\|\]\]}}`) markeddownReg = regexp.MustCompile("

(.+)

") ) func (p *Post) formatContent(cfg *config.Config, c *Collection, isOwner bool) { baseURL := c.CanonicalURL() + // TODO: redundant if !isSingleUser { baseURL = "/" + c.Alias + "/" } p.HTMLTitle = template.HTML(applyBasicMarkdown([]byte(p.Title.String))) p.HTMLContent = template.HTML(applyMarkdown([]byte(p.Content), baseURL, cfg)) if exc := strings.Index(string(p.Content), ""); exc > -1 { p.HTMLExcerpt = template.HTML(applyMarkdown([]byte(p.Content[:exc]), baseURL, cfg)) } } func (p *PublicPost) formatContent(cfg *config.Config, isOwner bool) { p.Post.formatContent(cfg, &p.Collection.Collection, isOwner) } func applyMarkdown(data []byte, baseURL string, cfg *config.Config) string { return applyMarkdownSpecial(data, false, baseURL, cfg) } func applyMarkdownSpecial(data []byte, skipNoFollow bool, baseURL string, cfg *config.Config) string { mdExtensions := 0 | blackfriday.EXTENSION_TABLES | blackfriday.EXTENSION_FENCED_CODE | blackfriday.EXTENSION_AUTOLINK | blackfriday.EXTENSION_STRIKETHROUGH | blackfriday.EXTENSION_SPACE_HEADERS | blackfriday.EXTENSION_AUTO_HEADER_IDS htmlFlags := 0 | blackfriday.HTML_USE_SMARTYPANTS | blackfriday.HTML_SMARTYPANTS_DASHES if baseURL != "" { htmlFlags |= blackfriday.HTML_HASHTAGS } // Generate Markdown md := blackfriday.Markdown([]byte(data), blackfriday.HtmlRenderer(htmlFlags, "", ""), mdExtensions) if baseURL != "" { // Replace special text generated by Markdown parser tagPrefix := baseURL + "tag:" if cfg.App.Chorus { tagPrefix = "/read/t/" } md = []byte(hashtagReg.ReplaceAll(md, []byte("#$1"))) } // Strip out bad HTML policy := getSanitizationPolicy() policy.RequireNoFollowOnLinks(!skipNoFollow) outHTML := string(policy.SanitizeBytes(md)) // Strip newlines on certain block elements that render with them outHTML = blockReg.ReplaceAllString(outHTML, "<$1>") outHTML = endBlockReg.ReplaceAllString(outHTML, "") // Remove all query parameters on YouTube embed links // TODO: make this more specific. Taking the nuclear approach here to strip ?autoplay=1 outHTML = youtubeReg.ReplaceAllString(outHTML, "$1") return outHTML } func applyBasicMarkdown(data []byte) string { mdExtensions := 0 | blackfriday.EXTENSION_STRIKETHROUGH | blackfriday.EXTENSION_SPACE_HEADERS | blackfriday.EXTENSION_HEADER_IDS htmlFlags := 0 | blackfriday.HTML_SKIP_HTML | blackfriday.HTML_USE_SMARTYPANTS | blackfriday.HTML_SMARTYPANTS_DASHES // Generate Markdown md := blackfriday.Markdown([]byte(data), blackfriday.HtmlRenderer(htmlFlags, "", ""), mdExtensions) // Strip out bad HTML policy := bluemonday.UGCPolicy() policy.AllowAttrs("class", "id").Globally() outHTML := string(policy.SanitizeBytes(md)) outHTML = markeddownReg.ReplaceAllString(outHTML, "$1") outHTML = strings.TrimRightFunc(outHTML, unicode.IsSpace) return outHTML } func postTitle(content, friendlyId string) string { const maxTitleLen = 80 // Strip HTML tags with bluemonday's StrictPolicy, then unescape the HTML // entities added in by sanitizing the content. content = html.UnescapeString(bluemonday.StrictPolicy().Sanitize(content)) content = strings.TrimLeftFunc(stripmd.Strip(content), unicode.IsSpace) eol := strings.IndexRune(content, '\n') blankLine := strings.Index(content, "\n\n") if blankLine != -1 && blankLine <= eol && blankLine <= assumedTitleLen { return strings.TrimSpace(content[:blankLine]) } else if utf8.RuneCountInString(content) <= maxTitleLen { return content } return friendlyId } // TODO: fix duplicated code from postTitle. postTitle is a widely used func we // don't have time to investigate right now. func friendlyPostTitle(content, friendlyId string) string { const maxTitleLen = 80 // Strip HTML tags with bluemonday's StrictPolicy, then unescape the HTML // entities added in by sanitizing the content. content = html.UnescapeString(bluemonday.StrictPolicy().Sanitize(content)) content = strings.TrimLeftFunc(stripmd.Strip(content), unicode.IsSpace) eol := strings.IndexRune(content, '\n') blankLine := strings.Index(content, "\n\n") if blankLine != -1 && blankLine <= eol && blankLine <= assumedTitleLen { return strings.TrimSpace(content[:blankLine]) } else if eol == -1 && utf8.RuneCountInString(content) <= maxTitleLen { return content } title, truncd := parse.TruncToWord(parse.PostLede(content, true), maxTitleLen) if truncd { title += "..." } return title } func getSanitizationPolicy() *bluemonday.Policy { policy := bluemonday.UGCPolicy() policy.AllowAttrs("src", "style").OnElements("iframe", "video", "audio") policy.AllowAttrs("src", "type").OnElements("source") policy.AllowAttrs("frameborder", "width", "height").Matching(bluemonday.Integer).OnElements("iframe") policy.AllowAttrs("allowfullscreen").OnElements("iframe") policy.AllowAttrs("controls", "loop", "muted", "autoplay").OnElements("video") policy.AllowAttrs("controls", "loop", "muted", "autoplay", "preload").OnElements("audio") policy.AllowAttrs("target").OnElements("a") policy.AllowAttrs("style", "class", "id").Globally() policy.AllowURLSchemes("http", "https", "mailto", "xmpp") return policy } func sanitizePost(content string) string { return strings.Replace(content, "<", "<", -1) } // postDescription generates a description based on the given post content, // title, and post ID. This doesn't consider a V2 post field, `title` when // choosing what to generate. In case a post has a title, this function will // fail, and logic should instead be implemented to skip this when there's no // title, like so: // var desc string // if title == "" { // desc = postDescription(content, title, friendlyId) // } else { // desc = shortPostDescription(content) // } func postDescription(content, title, friendlyId string) string { maxLen := 140 if content == "" { content = "WriteFreely is a painless, simple, federated blogging platform." } else { fmtStr := "%s" truncation := 0 if utf8.RuneCountInString(content) > maxLen { // Post is longer than the max description, so let's show a better description fmtStr = "%s..." truncation = 3 } if title == friendlyId { // No specific title was found; simply truncate the post, starting at the beginning content = fmt.Sprintf(fmtStr, strings.Replace(stringmanip.Substring(content, 0, maxLen-truncation), "\n", " ", -1)) } else { // There was a title, so return a real description blankLine := strings.Index(content, "\n\n") if blankLine < 0 { blankLine = 0 } truncd := stringmanip.Substring(content, blankLine, blankLine+maxLen-truncation) contentNoNL := strings.Replace(truncd, "\n", " ", -1) content = strings.TrimSpace(fmt.Sprintf(fmtStr, contentNoNL)) } } return content } func shortPostDescription(content string) string { maxLen := 140 fmtStr := "%s" truncation := 0 if utf8.RuneCountInString(content) > maxLen { // Post is longer than the max description, so let's show a better description fmtStr = "%s..." truncation = 3 } return strings.TrimSpace(fmt.Sprintf(fmtStr, strings.Replace(stringmanip.Substring(content, 0, maxLen-truncation), "\n", " ", -1))) }